CAS 5466-54-6
:dimercaptomaleonitrile disodium salt hydrate
Description:
Dimercaptomaleonitrile disodium salt hydrate, with the CAS number 5466-54-6, is a chemical compound characterized by its unique structure that includes two thiol (sulfhydryl) groups and a maleonitrile moiety. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of sodium ions, which enhance its solubility. The disodium salt form indicates that it has two sodium ions associated with the molecule, contributing to its ionic nature. Dimercaptomaleonitrile disodium salt hydrate is known for its potential applications in various fields, including biochemistry and materials science, particularly as a chelating agent or in the synthesis of other chemical compounds. Its thiol groups can participate in redox reactions and form complexes with metal ions, making it useful in analytical chemistry. Additionally, the hydrate form suggests that it contains water molecules in its crystalline structure, which can influence its stability and reactivity. Overall, this compound exhibits interesting chemical properties that make it valuable for research and industrial applications.
Formula:C4H2N2S2
InChI:InChI=1/C4H2N2S2/c5-1-3(7)4(8)2-6/h7-8H/b4-3+
Synonyms:- Disodium dimercaptomaleonitrile
- (2E)-2,3-disulfanylbut-2-enedinitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Disodium Dimercaptomaleonitrile
CAS:Formula:C4N2Na2S2Purity:>90.0%(N)Color and Shape:White to Amber powder to crystalMolecular weight:186.16Disodium Dimercaptomaleonitrile
CAS:Disodium DimercaptomaleonitrilePurity:90%Molecular weight:186.17g/mol


