CAS 5466-62-6
:4,6-Dihydroxynicotinic acid
Description:
4,6-Dihydroxynicotinic acid, with the CAS number 5466-62-6, is a derivative of nicotinic acid, characterized by the presence of two hydroxyl (-OH) groups at the 4 and 6 positions of the pyridine ring. This compound is a white to off-white crystalline solid that is soluble in water and polar organic solvents, reflecting its hydrophilic nature due to the hydroxyl groups. It exhibits acidic properties, typical of carboxylic acids, and can participate in various chemical reactions, including esterification and oxidation. The presence of hydroxyl groups enhances its potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. 4,6-Dihydroxynicotinic acid is of interest in various fields, including medicinal chemistry, where it may serve as a precursor for the synthesis of biologically active compounds or as a ligand in coordination chemistry. Its structural features may also contribute to its biological activities, making it a subject of research in pharmacology and biochemistry.
Formula:C15H10ClN3O5
InChI:InChI=1/C15H10ClN3O5/c16-12-6-10(19(21)22)2-3-11(12)15(20)18-17-7-9-1-4-13-14(5-9)24-8-23-13/h1-7H,8H2,(H,18,20)/b17-7+
Synonyms:- Nicotinic acid, 4,6-dihydroxy-
- Brn 0137085
- Nsc 25748
- Nsc 26363
- 3-Pyridinecarboxylic acid, 1,6-dihydro-4-hydroxy-6-oxo-
- 6-Hydroxy-4-Oxo-1,4-Dihydropyridine-3-Carboxylic Acid
- N'-[(1E)-1,3-benzodioxol-5-ylmethylidene]-2-chloro-4-nitrobenzohydrazide
- 2,4-Dihydroxy-5-pyridinecarboxylicacid
- 2,4-Dihydroxy-5-pyridinecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4,6-Dihydroxynicotinic acid
CAS:Formula:C6H5NO4Purity:98%Color and Shape:SolidMolecular weight:155.10824,6-Dihydroxynicotinic acid
CAS:4,6-Dihydroxynicotinic acidPurity:≥95%Color and Shape:SolidMolecular weight:155.11g/mol4,6-Dihydroxynicotinic acid
CAS:Formula:C6H5NO4Purity:97%Color and Shape:SolidMolecular weight:155.109


