CAS 54663-78-4

2-Thiophenyltri-n-butyltin

Description:

2-Thiophenyltri-n-butyltin, with the CAS number 54663-78-4, is an organotin compound characterized by the presence of a thiophene ring and three n-butyltin groups. This compound typically exhibits a white to light yellow solid appearance and is known for its applications in various fields, including organic synthesis and as a potential biocide. The presence of the thiophene moiety contributes to its unique electronic properties, making it useful in materials science and as a ligand in coordination chemistry. Organotin compounds, including this one, can exhibit toxicity, particularly to aquatic organisms, and thus require careful handling and regulation. The compound's stability and reactivity can be influenced by factors such as temperature and the presence of other chemical species. Additionally, its solubility in organic solvents allows for diverse applications in chemical reactions and formulations. Overall, 2-Thiophenyltri-n-butyltin serves as an interesting subject of study due to its structural features and potential utility in various chemical processes.

Formula: C₁₆H₃₀SSn

InChI: InChI=1/C4H3S.3C4H9.Sn/c1-2-4-5-3-1;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3;/rC16H30SSn/c1-4-7-13-18(14-8-5-2,15-9-6-3)16-11-10-12-17-16/h10-12H,4-9,13-15H2,1-3H3

SMILES: CCCC[Sn](CCCC)(CCCC)c1cccs1

2-(Tri-n-butylstannyl)thiophene, 97%

CAS: 54663-78-4

2-(Tri-n-butylstannyl)thiophene derivative is employed in Stille reaction involving efficient carbon-carbon bond formation. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand.

Formula: C₁₆H₃₀SSn

Purity: 97%

Molecular weight: 373.16

Ref: 02-H55904

Tributyl(thiophen-2-yl)stannane

CAS: 54663-78-4

Formula: C₁₆H₃₀SSn

Purity: 97%

Color and Shape: Liquid

Molecular weight: 373.1754

Ref: IN-DA0037A5

2-(Tributylstannyl)thiophene

CAS: 54663-78-4

2-(Tributylstannyl)thiophene

Formula: C₁₆H₃₀SSn

Purity: ≥95%

Color and Shape: clear. almost colourless liquid

Molecular weight: 373.18439g/mol

Ref: 54-OR25730

2-(Tributylstannyl)thiophene

Controlled Product

CAS: 54663-78-4

2-Tributylstannylthiophene is a molecule that is used in organic synthesis. It is synthesized by the cross-coupling of 2-bromothiophene and tributyltin chloride. This molecule has been shown to be thermochromic, meaning that it changes color with a change in temperature. The color changes from yellow at lower temperatures to red at higher temperatures. 2-Tributylstannylthiophene has been shown to have optical properties, such as fluorescence and absorption, which are dependent on its molecular structure. It also has chemical properties, such as acidity, which can be altered by substituents on the carbon atoms of the molecule. 2-Tributylstannylthiophene can be used as a monomer for an organic material with constant optical properties because it does not undergo any reactions when exposed to inorganic acids or bases.

Formula: C₁₆H₃₀SSn

Purity: Min. 95%

Molecular weight: 373.18 g/mol

Ref: 3D-ECA66378