CAS 54664-61-8

cis-3,5-diacetoxy-1-cyclopentene

Description:

Cis-3,5-diacetoxy-1-cyclopentene is an organic compound characterized by its unique cyclic structure and functional groups. As a derivative of cyclopentene, it features a five-membered carbon ring with a double bond, which contributes to its reactivity and stability. The presence of two acetoxy groups (-OCOCH3) at the 3 and 5 positions enhances its polar characteristics and solubility in organic solvents. This compound is typically a colorless to pale yellow liquid and may exhibit a pleasant odor. Its molecular structure allows for specific stereochemistry, with the "cis" configuration indicating that the acetoxy groups are on the same side of the double bond, influencing its chemical behavior and interactions. Cis-3,5-diacetoxy-1-cyclopentene can participate in various chemical reactions, including nucleophilic substitutions and eliminations, making it of interest in synthetic organic chemistry. Additionally, its derivatives may have applications in pharmaceuticals and agrochemicals due to their potential biological activity.

Formula: C₉H₁₂O₄

InChI: InChI=1/C9H12O4/c1-6(10)12-8-3-4-9(5-8)13-7(2)11/h3-4,8-9H,5H2,1-2H3/t8-,9+

Synonyms:

• cis-3,5-Diacetoxycyclopentene
• (1R,3S)-cyclopent-4-ene-1,3-diyl diacetate

cis-3,5-Diacetoxycyclopentene

CAS: 54664-61-8

Formula: C₉H₁₂O₄

Purity: 96%

Color and Shape: Liquid

Molecular weight: 184.1892

Ref: IN-DA0038NQ

cis-3,5-Diacetoxy-1-cyclopentene

CAS: 54664-61-8

cis-3,5-Diacetoxy-1-cyclopentene

Purity: 98%

Color and Shape: Pale Yellow Liquid

Molecular weight: 184.19g/mol

Ref: 54-OR315274

cis-3,5-Diacetoxy-1-cyclopentene

CAS: 54664-61-8

Formula: C₉H₁₂O₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 184.191

Ref: 10-F501790