CAS 5468-68-8

4-[(butylamino)methyl]-N,N-diethylaniline

Description:

4-[(Butylamino)methyl]-N,N-diethylaniline, with the CAS number 5468-68-8, is an organic compound that belongs to the class of amines and anilines. It features a butylamino group attached to a benzene ring, which is further substituted with two ethyl groups on the nitrogen atom, contributing to its overall structure and properties. This compound is typically characterized by its moderate to high solubility in organic solvents, while its solubility in water may vary depending on the pH and temperature. It is often used in various chemical applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. The presence of the butylamino group can influence its reactivity and interaction with other chemical species. Safety data indicates that, like many amines, it may pose health risks if inhaled or ingested, necessitating appropriate handling and storage measures. Overall, 4-[(butylamino)methyl]-N,N-diethylaniline is a versatile compound with significant industrial relevance.

Formula: C₁₅H₂₆N₂

InChI: InChI=1/C15H26N2/c1-4-7-12-16-13-14-8-10-15(11-9-14)17(5-2)6-3/h8-11,16H,4-7,12-13H2,1-3H3

SMILES: CCCCNCc1ccc(cc1)N(CC)CC

Synonyms:

• Benzenemethanamine, N-butyl-4-(diethylamino)-

4-[(butylamino)methyl]-N,N-diethylaniline

CAS: 5468-68-8

Formula: C₁₅H₂₆N₂

Purity: 95.0%

Molecular weight: 234.387

Ref: 10-F523133