CAS 54698-60-1
:1-benzyl-5-methyl-1H-1,2,3-triazole-4-carboxylic acid
Description:
1-Benzyl-5-methyl-1H-1,2,3-triazole-4-carboxylic acid is a heterocyclic organic compound characterized by the presence of a triazole ring, which is a five-membered ring containing three nitrogen atoms. This compound features a benzyl group and a methyl group attached to the triazole, contributing to its unique chemical properties. The carboxylic acid functional group (-COOH) enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. The presence of the triazole moiety often imparts biological activity, making such compounds of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit properties such as antimicrobial or antifungal activity, depending on its structural modifications and substituents. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions, and it can be analyzed using techniques like NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 1-benzyl-5-methyl-1H-1,2,3-triazole-4-carboxylic acid is a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C11H11N3O2
InChI:InChI=1/C11H11N3O2/c1-8-10(11(15)16)12-13-14(8)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,15,16)
SMILES:Cc1c(C(=O)O)nnn1Cc1ccccc1
Synonyms:- 1H-1,2,3-triazole-4-carboxylic acid, 5-methyl-1-(phenylmethyl)-
- 1-Benzyl-4-carboxy-5-methyl-1H-1,2,3-triazole
- 1-Benzyl-5-methyl-1H-1,2,3-triazole-4-carboxylic acid
- 1-BENZYL-5-METHYL-1H-[1,2,3]TRIAZOLE-4-CARBOXYLIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Benzyl-5-methyl-1H-[1,2,3]triazole-4-carboxylic Acid
CAS:Formula:C11H11N3O2Purity:95%Color and Shape:SolidMolecular weight:217.22391-Benzyl-5-methyl-1H-1,2,3-triazole-4-carboxylic acid
CAS:<p>1-Benzyl-5-methyl-1H-1,2,3-triazole-4-carboxylic acid</p>Purity:95%Color and Shape:White PowderMolecular weight:217.22g/mol1-Benzyl-5-methyl-1H-[1,2,3]triazole-4-carboxylic acid
CAS:Formula:C11H11N3O2Purity:95%Color and Shape:SolidMolecular weight:217.2281-Benzyl-5-methyl-1H-[1,2,3]triazole-4-carboxylic Acid
CAS:Controlled ProductFormula:C11H11N3O2Color and Shape:NeatMolecular weight:280.2371-Benzyl-5-methyl-1H-1,2,3-triazole-4-carboxylic acid
CAS:<p>1-Benzyl-5-methyl-1H-1,2,3-triazole-4-carboxylic acid is a compound with an esterified hydroxyl group in the form of an acetylacetone. It can be used as a monohydrate or dihydrate and it is stabilized by hydrogen bonding. 1-Benzyl-5-methyl-1H-1,2,3-triazole-4-carboxylic acid has been studied as a potential drug for cancer treatment because it is active against tumor cells and has little toxicity to normal cells.</p>Formula:C11H11N3O2Purity:Min. 95%Molecular weight:217.22 g/mol




