CAS 547-91-1: Ferron
Description:Ferron, with the CAS number 547-91-1, is a chemical compound primarily known for its role as a chelating agent, particularly in the context of iron. It is often utilized in various applications, including analytical chemistry and environmental studies, due to its ability to form stable complexes with iron ions. This property makes Ferron valuable in the extraction and determination of iron in different matrices. The compound is typically characterized by its ability to enhance the solubility of iron, facilitating its detection and quantification. Ferron is also noted for its stability in various pH conditions, which allows it to function effectively in diverse environments. Additionally, it may exhibit specific reactivity with other metal ions, making it a useful tool in studies involving metal ion interactions. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C9H6INO4S
InChI:InChI=1S/C9H6INO4S/c10-6-4-7(16(13,14)15)5-2-1-3-11-8(5)9(6)12/h1-4,12H,(H,13,14,15)
InChI key:InChIKey=ZBJWWKFMHOAPNS-UHFFFAOYSA-N
SMILES:O=S(=O)(O)C=1C=C(I)C(O)=C2N=CC=CC21
- Synonyms:
- 5-Quinolinesulfonic acid, 8-hydroxy-7-iodo-
- 5-Sulfo-7-iodo-8-hydroxyquinoline
- 5-Sulfo-7-iodo-8-quinolinol
- 7-Iodo-5-sulfonic acid-8-hydroxyquinoline
- 7-Iodo-8-hydroxylquinoline-5-sulfonic acid
- 7-Iodo-8-hydroxyquinoline-5-sulfonic acid
- 7-Iodo-8-quinolinol-5-sulfonic acid
- 7-Iodooxine-5-sulfonic acid
- 8-Hydroxy-7-iodo-5-quinolinesulfonic acid
- Ferron
- See more synonyms
- Ferron (analytical reagent)
- Loretin
- Meditrene
- NSC 3784
- Quiniophen
- Yellon
