CAS 5470-15-5
:1-methylethyl 4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Description:
1-Methylethyl 4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate, with the CAS number 5470-15-5, is a chemical compound that belongs to the class of quinoline derivatives. This substance typically exhibits a complex molecular structure characterized by a hexahydroquinoline core, which is a bicyclic compound featuring a nitrogen atom in its ring system. The presence of methoxy groups on the phenyl ring contributes to its potential biological activity, as these substituents can influence the compound's solubility and reactivity. The carboxylate functional group suggests that it may participate in various chemical reactions, including esterification and acid-base interactions. Additionally, the compound's oxo group indicates the presence of a carbonyl functionality, which can play a crucial role in its reactivity and interactions with other molecules. Overall, this compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could be linked to various biological activities.
Formula:C7H5Cl2NO
InChI:InChI=1/C22H27NO5/c1-12(2)28-22(25)19-13(3)23-15-7-6-8-16(24)21(15)20(19)14-9-10-17(26-4)18(11-14)27-5/h9-12,20,23H,6-8H2,1-5H3
InChI key:InChIKey=WTKFBCXCSGVNOE-UHFFFAOYSA-N
SMILES:N(C=O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- 3,4-Dichloro-N-formylaniline
- 3-Quinolinecarboxylic Acid, 4-(3,4-Dimethoxyphenyl)-1,4,5,6,7,8-Hexahydro-2-Methyl-5-Oxo-, 1-Methylethyl Ester
- 3′,4′-Dichloroformanilide
- Formamide, N-(3,4-dichlorophenyl)-
- Formanilide, 3′,4′-dichloro-
- Isopropyl 4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
- N-(3,4-Dichlorophenyl)formamide
- N-Formyl-3,4-dichloroaniline
- NSC 26269
- N-(3,4-DICHLORO-PHENYL)-FORMAMIDE
- 3',4'-DICHLOROFORMANILIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3',4'-Dichloroformanilide
CAS:Controlled ProductFormula:C7H5Cl2NOColor and Shape:NeatMolecular weight:190.027
