CAS 5470-65-5

3-bromo-4-nitrophenol

Description:

3-Bromo-4-nitrophenol is an organic compound characterized by the presence of both bromine and nitro functional groups attached to a phenolic ring. Its molecular structure features a bromine atom at the meta position and a nitro group at the para position relative to the hydroxyl (-OH) group on the benzene ring. This compound typically appears as a yellow to orange solid and is known for its moderate solubility in organic solvents and limited solubility in water. It exhibits acidic properties due to the hydroxyl group, which can donate a proton in solution. 3-Bromo-4-nitrophenol is often used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, it can serve as a reagent in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety precautions should be taken when handling this compound, as it may pose health risks, including skin and eye irritation, and potential environmental hazards.

Formula: C₆H₄BrNO₃

InChI: InChI=1/C6H4BrNO3/c7-5-3-4(9)1-2-6(5)8(10)11/h1-3,9H

SMILES: c1cc(c(cc1O)Br)N(=O)=O

Synonyms:

• Phenol, 3-Bromo-4-Nitro-

3-Bromo-4-nitrophenol

CAS: 5470-65-5

Formula: C₆H₄BrNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 218.0049

Ref: IN-DA003J2D

3-Bromo-4-nitrophenol

CAS: 5470-65-5

3-Bromo-4-nitrophenol

Purity: 97%

Molecular weight: 218.01g/mol

Ref: 54-OR75189

3-Bromo-4-nitrophenol

CAS: 5470-65-5

Formula: C₆H₄BrNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 218.006

Ref: 10-F211021

3-Bromo-4-nitrophenol

Controlled Product

CAS: 5470-65-5

Applications 3-Bromo-4-nitrophenol (cas# 5470-65-5) is a compound useful in organic synthesis.

Formula: C₆H₄BrNO₃

Color and Shape: Neat

Molecular weight: 218.00

Ref: TR-B686255