CymitQuimica logo

CAS 5470-68-8

:

5-methoxy-2-methylpentanoic acid

Description:
5-Methoxy-2-methylpentanoic acid, with the CAS number 5470-68-8, is an organic compound characterized by its carboxylic acid functional group and a methoxy group attached to a branched alkane chain. This compound features a five-carbon backbone, with a methyl group and a methoxy group contributing to its structural complexity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its methoxy group can influence its solubility and reactivity, making it more hydrophobic compared to similar compounds without this substituent. 5-Methoxy-2-methylpentanoic acid may have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.
Formula:C7H14O3
InChI:InChI=1/C7H14O3/c1-6(7(8)9)4-3-5-10-2/h6H,3-5H2,1-2H3,(H,8,9)
SMILES:CC(CCCOC)C(=O)O
Found 1 products.