CAS 54705-42-9
:(S)-4-tert-butyl-2-oxazolidinone
Description:
(S)-4-tert-butyl-2-oxazolidinone is a chiral compound that belongs to the class of oxazolidinones, which are five-membered heterocycles containing both nitrogen and oxygen atoms. This compound is characterized by its specific stereochemistry, indicated by the (S) configuration, which plays a crucial role in its biological activity and potential applications in pharmaceuticals. The tert-butyl group contributes to its hydrophobic properties, influencing solubility and interaction with biological membranes. Typically, oxazolidinones exhibit antibacterial properties, and this compound may serve as a building block in the synthesis of various biologically active molecules. Its molecular structure allows for potential applications in asymmetric synthesis, where the chiral center can be utilized to produce enantiomerically pure compounds. Additionally, (S)-4-tert-butyl-2-oxazolidinone may be involved in the development of new materials or as a ligand in coordination chemistry. Overall, its unique structural features and chirality make it a compound of interest in both synthetic and medicinal chemistry.
Formula:C7H13NO2
InChI:InChI=1/C7H13NO2/c1-7(2,3)5-4-10-6(9)8-5/h5H,4H2,1-3H3,(H,8,9)/t5-/m1/s1
SMILES:CC(C)(C)[C@H]1COC(=N1)O
Synonyms:- (4S)-(-)-4-tert-Butyl-2-oxazolidinone
- (4S)-4-tert-butyl-1,3-oxazolidin-2-one
- (s)-(-)-4-tert-butyl-2-oxazolidinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Oxazolidinone, 4-(1,1-dimethylethyl)-, (4S)-
CAS:Formula:C7H13NO2Purity:97%Color and Shape:SolidMolecular weight:143.1836(S)-4-tert-Butyl-2-oxazolidinone
CAS:(S)-4-tert-Butyl-2-oxazolidinonePurity:99%Molecular weight:143.18g/mol(S)-4-tert-Butyl-2-oxazolidinone
CAS:<p>(S)-4-tert-Butyl-2-oxazolidinone is a chiral, crystalline solid that can be used as an aldol. It is soluble in solvents and has low skin absorption. The compound is useful for the synthesis of sulfinyl compounds, which are used as reagents for asymmetric synthesis of amines. (S)-4-tert-Butyl-2-oxazolidinone can be used to synthesize conjugates with amino acids or nucleosides.</p>Formula:C7H13NO2Purity:Min. 95%Molecular weight:143.18 g/mol



