CAS 54705-91-8
:2-(1H-pyrazol-1-yl)aniline
Description:
2-(1H-pyrazol-1-yl)aniline, with the CAS number 54705-91-8, is an organic compound characterized by the presence of both an aniline and a pyrazole functional group. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its ability to act as a building block in the synthesis of more complex molecules. The presence of the pyrazole ring contributes to its unique chemical reactivity, allowing for various substitution reactions. It is generally soluble in organic solvents, and its properties can vary based on the specific conditions of use, such as pH and temperature. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance. Overall, 2-(1H-pyrazol-1-yl)aniline is a versatile compound with significant implications in chemical research and development.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c10-8-4-1-2-5-9(8)12-7-3-6-11-12/h1-7H,10H2
SMILES:c1ccc(c(c1)N)n1cccn1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenamine, 2-(1H-pyrazol-1-yl)-
CAS:Formula:C9H9N3Purity:98%Color and Shape:SolidMolecular weight:159.18792-(1H-Pyrazol-1-yl)aniline
CAS:2-(1H-Pyrazol-1-yl)anilineFormula:C9H9N3Purity:≥95%Color and Shape: dark brown crystalsMolecular weight:159.19g/mol1-(2-Aminophenyl)-1H-pyrazole
CAS:1-(2-Aminophenyl)-1H-pyrazole is a chemical compound that is used in the synthesis of other compounds. It can be produced by various reactions from benzyl chloride and ammonia. The reactivity of 1-(2-aminophenyl)-1H-pyrazole has been studied using single crystal X-ray diffraction. This technique was used to determine the structure and reaction pathway of this molecule as well as to study its catalytic properties. 1-(2-Aminophenyl)-1H-pyrazole is a ligand that binds to metal ions, such as aluminium, in order to form complexes with different functional groups.
Formula:C9H9N3Purity:Min. 95%Molecular weight:159.19 g/mol



