CAS 54709-94-3

3-Hydroxy-5-methylpyridazine

Description:

3-Hydroxy-5-methylpyridazine, with the CAS number 54709-94-3, is a heterocyclic organic compound that features a pyridazine ring, which is a six-membered ring containing two nitrogen atoms at positions 1 and 2. This compound is characterized by the presence of a hydroxyl group (-OH) at the 3-position and a methyl group (-CH3) at the 5-position of the pyridazine ring. It is typically a crystalline solid and may exhibit solubility in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The presence of the methyl group can influence its chemical reactivity and stability. 3-Hydroxy-5-methylpyridazine may have applications in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups or substituents. As with many organic compounds, safety data should be consulted for handling and usage.

Formula: C₅H₆N₂O

InChI: InChI=1/C5H6N2O/c1-4-2-5(8)7-6-3-4/h2-3H,1H3,(H,7,8)

SMILES: Cc1cc(nnc1)O

Synonyms:

• 5-Methyl-3(2H)-Pyridazinone
• 5-methylpyridazin-3(2H)-one

5-Methyl-3(2H)-pyridazinone

CAS: 54709-94-3

Formula: C₅H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 110.1139

Ref: IN-DA003MVG

5-Methyl-2H-pyridazin-3-one

CAS: 54709-94-3

5-Methyl-2H-pyridazin-3-one

Purity: 98%

Molecular weight: 110.11g/mol

Ref: 54-OR2216

5-Methylpyridazin-3(2H)-one

CAS: 54709-94-3

Formula: C₅H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 110.116

Ref: 10-F068753