CAS 5472-37-7
:N-(2-amino-4-methoxyphenyl)acetamide
Description:
N-(2-amino-4-methoxyphenyl)acetamide, also known by its CAS number 5472-37-7, is an organic compound characterized by its amide functional group. This substance features a phenyl ring substituted with an amino group and a methoxy group, which contribute to its chemical reactivity and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The methoxy group can influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. N-(2-amino-4-methoxyphenyl)acetamide may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in the synthesis of compounds with therapeutic effects. Additionally, the compound's stability, melting point, and solubility can vary based on environmental conditions and the presence of other substances. Overall, this compound represents a versatile structure in organic and medicinal chemistry, warranting further investigation for its potential uses.
Formula:C9H12N2O2
InChI:InChI=1/C9H12N2O2/c1-6(12)11-9-4-3-7(13-2)5-8(9)10/h3-5H,10H2,1-2H3,(H,11,12)
SMILES:CC(=Nc1ccc(cc1N)OC)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Amino-4-methoxyacetanilide
CAS:<p>2-Amino-4-methoxyacetanilide</p>Purity:95%Molecular weight:180.20g/molN-(2-Amino-4-methoxyphenyl)acetamide
CAS:Formula:C9H12N2O2Purity:95.0%Color and Shape:Brown powderMolecular weight:180.207N-(2-Amino-4-methoxyphenyl)acetamide
CAS:N-(2-Amino-4-methoxyphenyl)acetamide (ACAM) is a chemical compound that is used as a precursor in the synthesis of various organic compounds. It is an amide derivative of acetanilide and can be synthesized by the reaction of potassium cyanide with 2-methoxybenzaldehyde, followed by cyclization with potassium hydroxide and methanol. ACAM has been shown to result in unambiguous identification of potassium cyanide in environmental samples.Formula:C9H12N2O2Purity:Min. 95%Molecular weight:180.21 g/mol


