CAS 5472-41-3
:4-Amino-6-hydroxypyrazolo[3,4-d]pyrimidine
Description:
4-Amino-6-hydroxypyrazolo[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both amino and hydroxyl functional groups. This compound typically appears as a crystalline solid and is soluble in polar solvents due to the presence of the hydroxyl group, which enhances its ability to engage in hydrogen bonding. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. It is often studied for its potential biological activities, particularly in the fields of medicinal chemistry and pharmacology, where it may exhibit properties such as anti-inflammatory or anti-cancer effects. The compound's structure allows for various modifications, which can lead to derivatives with enhanced biological activity or altered pharmacokinetic profiles. As with many heterocycles, its reactivity and interactions can be influenced by the electronic properties of the substituents on the ring, making it a subject of interest in synthetic and medicinal chemistry research.
Formula:C5H5N5O
InChI:InChI=1S/C5H5N5O/c6-3-2-1-7-10-4(2)9-5(11)8-3/h1H,(H4,6,7,8,9,10,11)
InChI key:InChIKey=KTQYLKORCCNJTQ-UHFFFAOYSA-N
SMILES:NC=1C2=C(NC(=O)N1)NN=C2
Synonyms:- 1H-Pyrazolo[3,4-d]pyrimidin-6-ol, 4-amino-
- 1H-Pyrazolo[3,4-d]pyrimidine, 4-amino-, 6-oxide
- 4-Amino-1,7-dihydro-6H-pyrazolo[3,4-d]pyrimidin-6-one
- 4-Amino-6-oxopyrazolo[3,4-d]pyrimidine
- 4-Aminopyrazolo(3,4-D)Pyrimidin-6-Ol
- 4-Aminopyrazolo[3,4-d]pyrimidine-6-ol
- 4-amino-1,2-dihydro-6H-pyrazolo[3,4-d]pyrimidin-6-one
- 6H-Pyrazolo[3,4-d]pyrimidin-6-one, 4-amino-1,5-dihydro-
- 6H-Pyrazolo[3,4-d]pyrimidin-6-one, 4-amino-1,7-dihydro-
- NSC 28415
- 4-AMINO-6-hydroxypyrazolo-(3,4-d)pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Amino-6-hydroxypyrazolo[3,4-d]pyrimidine
CAS:Formula:C5H5N5OColor and Shape:SolidMolecular weight:151.12614-Amino-6-hydroxypyrazolo-(3,4-d)pyrimidine
CAS:<p>4-Amino-6-hydroxypyrazolo-(3,4-d)pyrimidine</p>Purity:90%Molecular weight:151.13g/mol4-Amino-6-hydroxypyrazolo(3,4-D)pyrimidine
CAS:<p>4-Amino-6-hydroxypyrazolo(3,4-D)pyrimidine is an anti-inflammatory drug that is used to treat bowel disease. It is also used as a polymer conjugate to treat cancer, and in the prevention of transplant rejection. 4-Amino-6-hydroxypyrazolo(3,4-D)pyrimidine has been shown to have antioxidant properties and may be effective in preventing inflammatory diseases such as inflammatory bowel disease. It has also been shown to act as an antihypertensive agent by inhibiting angiotensin I converting enzyme (ACE).</p>Formula:C5H5N5OPurity:Min. 95%Molecular weight:151.13 g/mol4-Amino-6-hydroxypyrazolo[3,4-d]pyrimidine
CAS:Formula:C5H5N5OPurity:97.0%Color and Shape:Solid, Brown powderMolecular weight:151.1294-Amino-6-hydroxypyrazolo[3,4-d]pyrimidine
CAS:Formula:C5H5N5OPurity:>93.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystallineMolecular weight:151.13




