CAS 5472-71-9
:1-(4-Morpholinylmethyl)-1H-benzotriazole
Description:
1-(4-Morpholinylmethyl)-1H-benzotriazole, with the CAS number 5472-71-9, is an organic compound characterized by its benzotriazole core, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound features a morpholinylmethyl substituent, which contributes to its solubility and potential biological activity. It is typically a white to off-white solid and is soluble in organic solvents. The presence of the morpholine group may impart properties such as increased polarity and the ability to form hydrogen bonds, enhancing its interactions in various chemical environments. This compound is often studied for its applications in fields such as photostabilization, corrosion inhibition, and as a potential additive in polymers due to its UV-absorbing properties. Additionally, its unique structure may allow for interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C11H14N4O
InChI:InChI=1S/C11H14N4O/c1-2-4-11-10(3-1)12-13-15(11)9-14-5-7-16-8-6-14/h1-4H,5-9H2
InChI key:InChIKey=YZYQTUBWZGCDLR-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=N1)=CC=CC2)N3CCOCC3
Synonyms:- 1-(1-Morpholinomethyl)benzotriazole
- 1-(4-Morpholinylmethyl)-1H-benzotriazole
- 1-(morpholin-4-ylmethyl)-1H-benzotriazole
- 1-[(Morpholin-4-yl)methyl]-1H-1,2,3-benzotriazole
- 1-[(Morpholin-4-yl)methyl]-1H-benzotriazole
- 1H-Benzotriazole, 1-(4-morpholinylmethyl)-
- 1H-Benzotriazole, 1-(morpholinomethyl)-
- Bt 218
- N-(4-ethoxyphenyl)-4-fluoro-N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]benzenesulfonamide
- Nsc 29448
- 1-(4-Morpholinomethyl)-1H-benzotriazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
