CAS 5472-99-1
:1-chloro-3-methoxy-2-nitrobenzene
Description:
1-Chloro-3-methoxy-2-nitrobenzene, with the CAS number 5472-99-1, is an organic compound that belongs to the class of nitro-substituted aromatic compounds. It features a benzene ring substituted with a chlorine atom, a methoxy group (-OCH3), and a nitro group (-NO2) at specific positions. The presence of these functional groups imparts distinct chemical properties, such as increased reactivity and polarity. The chlorine atom is an electron-withdrawing group, which can enhance the electrophilic character of the aromatic ring, making it more susceptible to further substitution reactions. The methoxy group, being an electron-donating group, can influence the compound's reactivity and stability. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. It is important to handle this substance with care, as nitro compounds can be hazardous and may pose environmental risks. Proper safety protocols should be followed when working with or disposing of this chemical.
Formula:C7H6ClNO3
InChI:InChI=1/C7H6ClNO3/c1-12-6-4-2-3-5(8)7(6)9(10)11/h2-4H,1H3
SMILES:COc1cccc(c1N(=O)=O)Cl
Synonyms:- 3-Chloro-2-nitrophenyl methyl ether
- Benzene, 1-Chloro-3-Methoxy-2-Nitro-
- 1-Chloro-3-methoxy-2-nitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-chloro-3-methoxy-2-nitro-benzene
CAS:Formula:C7H6ClNO3Purity:97%Color and Shape:SolidMolecular weight:187.58041-Chloro-3-methoxy-2-nitrobenzene
CAS:1-Chloro-3-methoxy-2-nitrobenzene is an anomalous compound that reacts with water to produce hydrochloric acid and nitrous oxide. The reaction starts with cleavage of the C–C bond, followed by a rearrangement to form the methylenedioxy group. This leads to a nucleophilic attack on the aromatic ring, which causes it to become electrophilic and react with water. The temperature of this reaction is dependent on the concentration of hydrochloric acid.
Formula:C7H6ClNO3Purity:Min. 95%Molecular weight:187.58 g/mol



