CAS 54729-62-3

1,3-Dimethyl-5-methylamino-6-aminouracil

Description:

1,3-Dimethyl-5-methylamino-6-aminouracil, with the CAS number 54729-62-3, is a synthetic organic compound that belongs to the class of uracil derivatives. This substance features a pyrimidine ring structure, which is characteristic of nucleobases, and is modified by the presence of multiple methyl and amino groups. The presence of these functional groups contributes to its potential biological activity, particularly in relation to nucleic acid metabolism. The compound is typically characterized by its solubility in polar solvents, which is influenced by the amino and methyl groups that enhance its interaction with water. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents, although specific biological activities would need to be confirmed through empirical studies. Safety and handling precautions should be observed, as with any chemical substance, due to the potential for toxicity or reactivity. Overall, 1,3-Dimethyl-5-methylamino-6-aminouracil represents a notable example of modified nucleobase chemistry.

Formula: C₇H₁₂N₄O₂

InChI: InChI=1/C7H12N4O2/c1-9-4-5(8)10(2)7(13)11(3)6(4)12/h9H,8H2,1-3H3

SMILES: CNc1c(N)n(C)c(=O)n(C)c1=O

Synonyms:

• 6-Amino-1,3-dimethyl-5-(methylamino)-2,4(1H,3H)-pyrimidinedione
• 6-amino-1,3-dimethyl-5-(methylamino)pyrimidine-2,4(1H,3H)-dione