CAS 54746-50-8

N-nitroso-N-(prop-2-en-1-yl)but-3-en-1-amine

Description:

N-nitroso-N-(prop-2-en-1-yl)but-3-en-1-amine, with the CAS number 54746-50-8, is a nitrosamine compound characterized by the presence of a nitroso group (-N=O) attached to an amine. This compound features a prop-2-en-1-yl group and a but-3-en-1-amine structure, indicating it has both alkenyl and amine functionalities. Nitrosamines are known for their potential carcinogenic properties, often formed from the reaction of nitrites with secondary or tertiary amines under acidic conditions. The stability of this compound can be influenced by environmental factors such as temperature and pH, and it may undergo various chemical reactions, including decomposition and formation of other nitrosamines. Due to its potential health risks, handling and usage of this compound require strict safety measures. Its applications may be limited in research and industrial contexts, primarily due to the regulatory scrutiny surrounding nitrosamines. Overall, N-nitroso-N-(prop-2-en-1-yl)but-3-en-1-amine exemplifies the complex interplay between chemical structure and biological activity.

Formula: C₇H₁₂N₂O

InChI: InChI=1/C7H12N2O/c1-3-5-7-9(8-10)6-4-2/h3-4H,1-2,5-7H2

SMILES: C=CCCN(CC=C)N=O

N-Nitroso-N-Allyl-3-Buten-1-Amine

CAS: 54746-50-8

Formula: C₇H₁₂N₂O

Molecular weight: 140.19

Ref: 4Z-N-103043

3-Butenyl(2-propenyl)nitrosamine

Controlled Product

CAS: 54746-50-8

Applications 3-Butenyl(2-propenyl)nitrosamine is the principal volatile nitrosamine formed in the nitrosation of spermidine or spermine.
References Hildrum, K. I. et al.: Jou. of Agr. and Foo. Che., 23(1), 34-7, (1975)

Formula: C₇H₁₂N₂O

Color and Shape: Neat

Molecular weight: 140.183

Ref: TR-B621420

N-Nitroso-N-Allyl-3-Buten-1-Amine

CAS: 54746-50-8

Formula: C₇H₁₂N₂O

Molecular weight: 140.19

Ref: ST-EA-CP-NIT249