
CAS 54749-86-9
:Thiazolinobutazone
Description:
Thiazolinobutazone is a synthetic compound that belongs to the class of thiazolidinediones, which are known for their role in pharmacology, particularly in the treatment of diabetes. This compound features a thiazole ring fused with a butazone moiety, contributing to its unique chemical properties. Thiazolinobutazone exhibits anti-inflammatory and antioxidant activities, making it of interest in various therapeutic applications. It is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which can influence its bioavailability and pharmacokinetics. The compound's mechanism of action often involves modulation of insulin sensitivity and glucose metabolism, although specific pathways may vary. Additionally, thiazolinobutazone has been studied for its potential effects on lipid profiles and cardiovascular health. As with many synthetic compounds, safety and efficacy profiles are critical, and ongoing research continues to explore its full therapeutic potential and any associated side effects.
Formula:C19H20N2O2·C3H6N2S
InChI:InChI=1S/C19H20N2O2.C3H6N2S/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;4-3-5-1-2-6-3/h4-13,17H,2-3,14H2,1H3;1-2H2,(H2,4,5)
InChI key:InChIKey=IMKNHLPRDSWAHW-UHFFFAOYSA-N
SMILES:NC1=NCCS1.O=C1N(N(C(=O)C1CCCC)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- LAS 11871
- 2-Thiazolamine, 4,5-dihydro-, compd. with 4-butyl-1,2-diphenyl-3,5-pyrazolidinedione (1:1)
- Fordonal
- 3,5-Pyrazolidinedione, 4-butyl-1,2-diphenyl-, compd. with 4,5-dihydro-2-thiazolamine (1:1)
- Thiazolinobutazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thiazolinobutazone
CAS:<p>Thiazolinobutazone is the 2-amino-2-thiazoline salt of phenylbutazone.</p>Formula:C22H26N4O2SColor and Shape:SolidMolecular weight:410.53
