CAS 54749-91-6
:3-(2-chloroethyl)-1-cyclohexyl-1-nitrosourea
Description:
3-(2-chloroethyl)-1-cyclohexyl-1-nitrosourea, commonly referred to as CCNU or lomustine, is a synthetic organic compound classified as a nitrosourea. It is primarily used in the treatment of certain types of cancers, including brain tumors and lymphomas. The compound features a cyclohexyl group, which contributes to its lipophilicity, allowing it to penetrate biological membranes effectively. Its structure includes a chloroethyl moiety, which is crucial for its alkylating activity, enabling it to form covalent bonds with DNA, leading to cell death. CCNU is known for its moderate to high toxicity, necessitating careful handling and monitoring during therapeutic use. It is typically administered orally and is metabolized in the liver, with its effects being dose-dependent. Side effects may include myelosuppression, nausea, and potential long-term risks such as secondary malignancies. As a chemotherapeutic agent, CCNU exemplifies the use of alkylating agents in oncology, showcasing both therapeutic potential and associated risks.
Formula:C9H16ClN3O2
InChI:InChI=1/C9H16ClN3O2/c10-6-7-11-9(14)13(12-15)8-4-2-1-3-5-8/h8H,1-7H2,(H,11,14)
SMILES:C1CCC(CC1)N(C(=NCCCl)O)N=O
Synonyms:- urea, N'-(2-chloroethyl)-N-cyclohexyl-N-nitroso-
- 3-(2-Chloroethyl)-1-cyclohexyl-1-nitrosourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Lomustine Related Compound D (3-(2-Chloroethyl)-1-cyclohexyl-1-nitrosourea)
CAS:Compounds with other nitrogen function, nesoiFormula:C9H16ClN3O2Color and Shape:Light Yellow PowderMolecular weight:233.0931



