CymitQuimica logo

CAS 54767-71-4

:

Benzenemethanol, 4-[(1-methylethyl)thio]-α-[1-(octylamino)ethyl]-, hydrochloride, (R*,S*)-

Description:
Benzenemethanol, 4-[(1-methylethyl)thio]-α-[1-(octylamino)ethyl]-, hydrochloride, with the CAS number 54767-71-4, is a chemical compound characterized by its complex structure, which includes a benzene ring, a thioether group, and an aminoalkyl side chain. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, depending on the pH and the presence of the hydrochloride salt form. The presence of the thioether group contributes to its potential reactivity and biological activity, while the octylamino group may enhance its lipophilicity, influencing its pharmacokinetic properties. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. However, specific applications and safety profiles would require further investigation and analysis in the context of its intended use.
Formula:C20H35NOS·ClH
InChI:InChI=1/C20H35NOS.ClH/c1-5-6-7-8-9-10-15-21-17(4)20(22)18-11-13-19(14-12-18)23-16(2)3;/h11-14,16-17,20-22H,5-10,15H2,1-4H3;1H/t17-,20-;/s2
InChI key:InChIKey=JRJJHIUHSILDOH-ISVUVRSONA-N
SMILES:[C@H]([C@H](NCCCCCCCC)C)(O)C1=CC=C(SC(C)C)C=C1.Cl
Synonyms:
  • Benzenemethanol, 4-[(1-methylethyl)thio]-α-[1-(octylamino)ethyl]-, hydrochloride, (R*,S*)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.