CAS 547705-74-8

N-(2-chloropyridin-3-yl)-2-methylpropanamide

Description:

N-(2-chloropyridin-3-yl)-2-methylpropanamide is a chemical compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a pyridine ring substituted with a chlorine atom at the 2-position and is linked to a 2-methylpropanamide moiety. The presence of the chloropyridine structure contributes to its potential biological activity, as halogenated aromatic compounds often exhibit unique reactivity and interaction with biological targets. The amide group enhances the compound's solubility in polar solvents and may influence its pharmacokinetic properties. Additionally, the steric hindrance introduced by the 2-methyl group can affect the compound's conformation and reactivity. Overall, N-(2-chloropyridin-3-yl)-2-methylpropanamide is of interest in medicinal chemistry and may serve as a lead compound for the development of pharmaceuticals, particularly in the context of targeting specific biological pathways or receptors.

Formula: C₉H₁₁ClN₂O

InChI: InChI=1/C9H11ClN2O/c1-6(2)9(13)12-7-4-3-5-11-8(7)10/h3-6H,1-2H3,(H,12,13)

SMILES: CC(C)C(=Nc1cccnc1Cl)O

N-(2-chloro-3-pyridinyl)-2-methylpropanamide

CAS: 547705-74-8

Formula: C₉H₁₁ClN₂O

Molecular weight: 198.6494

Ref: IN-DA00DATW

N-(2-chloro-3-pyridinyl)-2-methylpropanamide

CAS: 547705-74-8

Formula: C₉H₁₁ClN₂O

Purity: 95.0%

Molecular weight: 198.65

Ref: 10-F315116