CAS 547757-23-3
:N-(1,8-dimethylimidazo[1,2-a]quinoxalin-4-yl)ethane-1,2-diamine hydrochloride
Description:
N-(1,8-dimethylimidazo[1,2-a]quinoxalin-4-yl)ethane-1,2-diamine hydrochloride is a chemical compound characterized by its complex structure, which includes an imidazoquinoxaline moiety and an ethane-1,2-diamine functional group. This compound is typically a hydrochloride salt, indicating that it is soluble in water and may exhibit different properties compared to its free base form. The presence of the dimethyl groups on the imidazoquinoxaline ring can influence its biological activity and solubility. As a derivative of imidazoquinoxaline, it may possess interesting pharmacological properties, potentially acting as a ligand or inhibitor in various biochemical pathways. The compound's molecular structure suggests it may engage in hydrogen bonding and other interactions, which could be relevant in drug design and development. Its specific applications and biological effects would depend on further empirical studies, including pharmacokinetics and toxicity assessments. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry.
Formula:C14H18ClN5
InChI:InChI=1/C14H17N5.ClH/c1-9-3-4-11-12(7-9)19-10(2)8-17-14(19)13(18-11)16-6-5-15;/h3-4,7-8H,5-6,15H2,1-2H3,(H,16,18);1H
SMILES:Cc1ccc2c(c1)n1c(C)cnc1c(NCCN)n2.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-(1,8-Dimethylimidazolo[1,2-A] Quinoxaline-4-Yl)-1,2-Ethylenediamine Hydrochloride
CAS:N-(1,8-Dimethylimidazolo[1,2-A] Quinoxaline-4-Yl)-1,2-Ethylenediamine HydrochloridePurity:99%Molecular weight:291.78g/molBMS-345541 hydrochloride
CAS:BMS-345541 hydrochloride is a selective IKK inhibitor (IKK2 and IKK1 with IC50 of 0.3 μM and 4 μM,respectively).Formula:C14H18ClN5Purity:99.13%Color and Shape:SolidMolecular weight:291.78BMS 345541
CAS:BMS 345541 is a selective inhibitor of IKK-β, which is an enzyme involved in the nuclear factor kappa-light-chain-enhancer of activated B cells (NF-κB) signaling pathway. It is synthesized through chemical synthesis, which allows for its precise targeting and modulation of specific signaling cascades.Formula:C14H17N5·HClPurity:Min. 95%Molecular weight:291.78 g/mol



