CAS 54779-81-6
:1-[1-(4-methylphenyl)ethylidene]-2-phenylhydrazine
Description:
1-[1-(4-Methylphenyl)ethylidene]-2-phenylhydrazine, with the CAS number 54779-81-6, is an organic compound characterized by its hydrazine functional group, which is known for its reactivity and ability to form various derivatives. This compound features a hydrazine moiety attached to a phenyl group and an ethylidene group substituted with a para-methylphenyl group, contributing to its structural complexity. The presence of the aromatic rings enhances its stability and may influence its solubility and reactivity in organic solvents. Typically, compounds of this nature can exhibit interesting biological activities, making them of interest in medicinal chemistry. Additionally, the presence of the methyl group can affect the electronic properties of the molecule, potentially influencing its interactions with other chemical species. As with many hydrazine derivatives, safety precautions should be taken due to potential toxicity and reactivity. Overall, this compound exemplifies the diverse chemistry associated with hydrazines and their derivatives in organic synthesis and applications.
Formula:C15H16N2
InChI:InChI=1/C15H16N2/c1-12-8-10-14(11-9-12)13(2)16-17-15-6-4-3-5-7-15/h3-11,17H,1-2H3
SMILES:Cc1ccc(cc1)C(=NNc1ccccc1)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Methylacetophenone Phenylhydrazone
CAS:Controlled ProductFormula:C15H16N2Color and Shape:NeatMolecular weight:224.301
