CAS 54783-95-8
:fortimicin B
Description:
Fortimicin B is an aminoglycoside antibiotic that is primarily derived from the fermentation of the bacterium Micromonospora purpurea. It exhibits a broad spectrum of antibacterial activity, particularly against Gram-negative bacteria, making it useful in treating various infections. The chemical structure of fortimicin B includes multiple amino groups, which contribute to its mechanism of action by binding to the bacterial ribosome, inhibiting protein synthesis. This antibiotic is known for its stability in the presence of certain enzymes that typically degrade other aminoglycosides, enhancing its efficacy. Fortimicin B is often used in clinical settings for its potent activity against resistant strains of bacteria. However, like other aminoglycosides, it can have nephrotoxic and ototoxic side effects, necessitating careful monitoring during treatment. Its solubility in water allows for various formulations, including injectable forms. Overall, fortimicin B represents an important tool in the antibiotic arsenal, particularly in the context of rising antibiotic resistance.
Formula:C15H32N4O5
InChI:InChI=1/C15H32N4O5/c1-6(16)8-5-4-7(17)15(23-8)24-13-9(18)11(20)14(22-3)10(19-2)12(13)21/h6-15,19-21H,4-5,16-18H2,1-3H3/t6-,7+,8-,9-,10-,11-,12+,13+,14+,15+/m0/s1
Synonyms:- 4-Amino-1,4-dideoxy-3-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-β-L-lyxo-heptopyranosyl)-6-O-methyl-1-methylamino-L-chiro-inositol
- fortimicin B
- L-chiro-Inositol, 4-amino-1,4-dideoxy-3-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-β-L-lyxo-heptopyranosyl)-6-O-methyl-1-(methylamino)-
- 4-Amino-1-(methylamino)-1,4-dideoxy-3-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-β-L-lyxo-heptopyranosyl)-6-O-methyl-L-chiro-inositol
- 4-Amino-1,4-dideoxy-3-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-beta-L-lyxo-heptopyranosyl)-6-O-methyl-1-(methylamino)-L-chiro-inositol
- Astromicin B
- (1R,2S,3S,4R,5S,6R)-2-amino-3,6-dihydroxy-5-(methylamino)-4-(methyloxy)cyclohexyl 2,6-diamino-2,3,4,6,7-pentadeoxy-beta-L-lyxo-heptopyranoside
- beta-L-lyxo-heptopyranoside, (1R,2S,3S,4R,5S,6R)-2-amino-3,6-dihydroxy-4-methoxy-5-(methylamino)cyclohexyl 2,6-diamino-2,3,4,6,7-pentadeoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fortimicin B
CAS:Fortimicin B exhibits weak antibacterial activity.Formula:C15H32N4O5Color and Shape:SolidMolecular weight:348.438
