CAS 54786-86-6
:N-Nitroso-3-azabicyclo[3.3.0]octane
Description:
N-Nitroso-3-azabicyclo[3.3.0]octane, with the CAS number 54786-86-6, is a chemical compound that belongs to the class of nitroso compounds. It features a bicyclic structure, which is characterized by a nitrogen atom incorporated into a bicyclic framework. This compound is known for its potential biological activity, particularly in the context of its nitrosamine properties, which can be associated with carcinogenic effects. The presence of the nitroso group (-N=O) is significant, as it can influence the reactivity and stability of the compound. N-Nitroso compounds are often formed from secondary amines and nitrous acid, and they can undergo various chemical transformations, including decomposition and reactions with nucleophiles. Due to its structural characteristics, N-Nitroso-3-azabicyclo[3.3.0]octane may exhibit unique interactions in biological systems, making it a subject of interest in toxicology and medicinal chemistry. However, handling and usage of this compound should be approached with caution due to its potential health risks.
Formula:C7H12N2O
InChI:InChI=1S/C7H12N2O/c10-8-9-4-6-2-1-3-7(6)5-9/h6-7H,1-5H2
InChI key:InChIKey=FSCBDDOKZIRLCN-UHFFFAOYSA-N
SMILES:N(=O)N1CC2C(C1)CCC2
Synonyms:- 2-Nitroso-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole
- 2-Nitroso-octahydrocyclopenta[c]pyrrole
- 2-Nitrosooctahydrocyclopenta[C]Pyrrole
- 3-Nitroso-3-azabicyclo[3.3.0]octane
- Cyclopenta[c]pyrrole, octahydro-2-nitroso-
- N-Nitroso-3-azabicyclo[3.3.0]octane
- Octahydro-2-nitrosocyclopenta(c)pyrrole
- Octahydro-2-nitrosocyclopenta[c]pyrrole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Gliclazide EP Impurity B
CAS:Formula:C7H12N2OColor and Shape:Light Yellow LiquidMolecular weight:140.192-Nitroso-octahydrocyclopenta[c]pyrrole
CAS:Controlled ProductFormula:C7H12N2OColor and Shape:NeatMolecular weight:140.18N-Nitroso-3-azabicyclo[3.3.0]octane
CAS:<p>N-Nitroso-3-azabicyclo[3.3.0]octane is a nitrosating agent that can be used for the determination of gliclazide in pharmaceuticals and other applications. It is synthesized by reacting 3-azabicyclo[3.3.0]octane with sodium nitrite in an alkaline environment, followed by hydrolysis with hydrochloric acid. Nitrosation reactions are usually slow, but N-nitroso-3-azabicyclo[3.3.0]octane has been shown to have a fast reaction kinetics, which makes it useful for the determination of gliclazide in pharmaceuticals and other applications. The product is analyzed using chromatographic techniques such as high performance liquid chromatography (HPLC) or gas chromatography/mass spectrometry (GC/MS). The product was found to be linear over the range of 0–</p>Formula:C7H12N2OPurity:Min. 95%Color and Shape:Colorless PowderMolecular weight:140.18 g/mol3-nitroso-3-azabicyclo[3.3.0]octane
CAS:3-nitroso-3-azabicyclo[3.3.0]octaneColor and Shape:Off White Solid






