CAS 54795-58-3
:Siastatin B
Description:
Siastatin B is a naturally occurring compound classified as a polyketide, primarily known for its antibiotic properties. It is produced by certain strains of the bacterium Streptomyces, which are renowned for their ability to synthesize a wide variety of bioactive secondary metabolites. Siastatin B exhibits a complex molecular structure characterized by multiple rings and functional groups, contributing to its biological activity. The compound has shown efficacy against various bacterial strains, making it a subject of interest in pharmaceutical research, particularly in the development of new antibiotics. Its mechanism of action typically involves inhibition of bacterial cell wall synthesis or interference with essential metabolic pathways. Additionally, Siastatin B may possess antifungal and antitumor properties, further expanding its potential applications in medicine. As with many natural products, the study of Siastatin B also includes investigations into its biosynthesis, ecological role, and potential for modification to enhance its therapeutic effects. Overall, Siastatin B represents a significant example of the diverse chemical arsenal found in microbial metabolites.
Formula:C8H14N2O5
InChI:InChI=1S/C8H14N2O5/c1-3(11)10-7-6(13)5(12)4(2-9-7)8(14)15/h4-7,9,12-13H,2H2,1H3,(H,10,11)(H,14,15)/t4-,5-,6-,7+/m0/s1
InChI key:InChIKey=DQTKLICLJUKNCG-ZTYPAOSTSA-N
SMILES:N(C(C)=O)[C@@H]1[C@@H](O)[C@@H](O)[C@@H](C(O)=O)CN1
Synonyms:- (3S,4S,5R,6R)-6-(Acetylamino)-4,5-dihydroxy-3-piperidinecarboxylic acid
- 3-Piperidinecarboxylic acid, 6-(acetylamino)-4,5-dihydroxy-, [3S-(3α,4α,5α,6β)]-
- 3-piperidinecarboxylic acid, 6-(acetylamino)-4,5-dihydroxy-, (3S,4S,5R,6R)-
- Siastatin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Siastatin B
CAS:Inhibitor of viral, bacterial and animal sialidaseFormula:C8H14N2O5Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:218.19 g/molSiastatin B
CAS:Siastatin B is a peptide that can be used as a research tool for studying protein interactions. It has been shown to be an activator of ligand-gated ion channels, such as nicotinic acetylcholine receptors and glutamate receptors. Siastatin B also binds to the neurotoxin receptor, which leads to the inhibition of the binding of neurotoxins to this receptor. The inhibitory activity of siastatin B is reversible and competitive with respect to the neurotoxin receptor. Siastatin B also inhibits cell proliferation at high concentrations.
Formula:C8H14N2O5Purity:Min. 95%Molecular weight:218.21 g/mol
