CAS 54796-49-5

4-(Methoxymethyl)-2-thiophenecarboxylic acid

Description:

4-(Methoxymethyl)-2-thiophenecarboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a carboxylic acid functional group (-COOH) and a methoxymethyl group (-OCH2-), which contribute to its chemical reactivity and potential applications. The presence of the thiophene ring imparts unique electronic properties, making it of interest in various fields such as pharmaceuticals, agrochemicals, and materials science. The methoxymethyl substituent can enhance solubility and influence the compound's interaction with biological systems. Additionally, the carboxylic acid group can participate in hydrogen bonding and acid-base reactions, further expanding its utility in synthetic chemistry. Overall, this compound's structural features suggest potential for use in the development of novel materials or as intermediates in organic synthesis.

Formula: C₇H₈O₃S

InChI: InChI=1S/C7H8O3S/c1-10-3-5-2-6(7(8)9)11-4-5/h2,4H,3H2,1H3,(H,8,9)

InChI key: InChIKey=DXFUEEMJYGBLKZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(COC)=CS1

Synonyms:

• 4-(Methoxymethyl)-2-thiophenecarboxylic acid
• 2-Thiophenecarboxylic acid, 4-(methoxymethyl)-

4-(Methoxymethyl)thiophene-2-carboxylic acid

CAS: 54796-49-5

Versatile small molecule scaffold

Formula: C₇H₈O₃S

Purity: Min. 95%

Molecular weight: 172.2 g/mol

Ref: 3D-ECA79649