CAS 54796-53-1

5-bromo-4-methylthiophene-2-carboxylic acid

Description:

5-Bromo-4-methylthiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 5-position and a methylthio group at the 4-position contributes to its unique reactivity and properties. The carboxylic acid functional group at the 2-position enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions, including esterification and amidation. This compound is often utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its ability to serve as a building block in organic synthesis. Additionally, the presence of the bromine atom can facilitate further functionalization through nucleophilic substitution reactions. Its molecular structure allows for potential applications in materials science, particularly in the development of conductive polymers and organic electronic devices. Overall, 5-bromo-4-methylthiophene-2-carboxylic acid is a versatile compound with significant implications in both research and industrial applications.

Formula: C₆H₅BrO₂S

InChI: InChI=1/C6H5BrO2S/c1-3-2-4(6(8)9)10-5(3)7/h2H,1H3,(H,8,9)

SMILES: Cc1cc(C(=O)O)sc1Br

5-Bromo-4-methylthiophene-2-carboxylic acid

CAS: 54796-53-1

Formula: C₆H₅BrO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 221.0717

Ref: IN-DA0037N9

5-Bromo-4-methylthiophene-2-carboxylic acid

CAS: 54796-53-1

5-Bromo-4-methylthiophene-2-carboxylic acid

Formula: C₆H₅BrO₂S

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 221.07g/mol

Ref: 54-OR960265

5-Bromo-4-methylthiophene-2-carboxylic acid

CAS: 54796-53-1

Formula: C₆H₅BrO₂S

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 221.07

Ref: 10-F244107

5-Bromo-4-methylthiophene-2-carboxylic acid

CAS: 54796-53-1

5-Bromo-4-methylthiophene-2-carboxylic acid (BMTCA) is a small molecule inhibitor of proteasome activity. It has been shown to be effective against life-threatening diseases and is currently in the process of optimization for use as a drug candidate. BMTCA binds to the active site of the endopeptidase, preventing it from cleaving peptides into amino acids, which prevents the formation of proteins. This action prevents cancer cells from proliferating, leading to an anti-tumor effect. The efficiency of this drug is related to its functional groups and affinity for the active site.br>br>

Formula: C₆H₅BrO₂S

Purity: Min. 95%

Molecular weight: 221.07 g/mol

Ref: 3D-ECA79653