CAS 54798-92-4

2-Phenyl-2H-tetrazole-5-carboxylic acid

Description:

2-Phenyl-2H-tetrazole-5-carboxylic acid is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a phenyl group attached to the tetrazole, contributing to its aromatic properties. The presence of a carboxylic acid functional group (-COOH) at the 5-position of the tetrazole ring imparts acidic characteristics, making it capable of donating protons in solution. The compound is typically white to off-white in appearance and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid group. It is often utilized in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and ability to act as a building block in the synthesis of more complex molecules. Additionally, the unique structure of 2-Phenyl-2H-tetrazole-5-carboxylic acid allows for various chemical modifications, enhancing its utility in research and development.

Formula: C₈H₆N₄O₂

InChI: InChI=1S/C8H6N4O2/c13-8(14)7-9-11-12(10-7)6-4-2-1-3-5-6/h1-5H,(H,13,14)

InChI key: InChIKey=YFIIOEOZTVRRDK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NN(N=N1)C2=CC=CC=C2

Synonyms:

• NSC 338123
• 2H-Tetrazole-5-carboxylic acid, 2-phenyl-
• 2-Phenyl-2H-1,2,3,4-tetrazole-5-carboxylic acid
• 2-Phenyl-2H-tetrazole-5-carboxylic acid
• 2-Phenyltetrazole-5-carboxylic acid

2-Phenyl-2H-1,2,3,4-tetrazole-5-carboxylic acid

CAS: 54798-92-4

Tetrazole is a heterocyclic compound that has the chemical formula C4H2N4. It is an aromatic heterocycle and can be used in organic synthesis. Tetrazole is synthesized by reacting sodium azide with a substituted hydrazine to produce a substituted hydrazide, which then reacts with nitrous acid to form a diazonium salt. This salt then undergoes hydrolysis to release the tetrazole product.

Formula: C₈H₆N₄O₂

Purity: Min. 95%

Molecular weight: 190.16 g/mol

Ref: 3D-ECA79892