CAS 54799-93-8
:N-benzoyl-L-phenylalanyl-N-{(2S)-5-[(diaminomethylidene)amino]-2-[(4-nitrophenyl)amino]pentanoyl}-L-valinamide
Description:
N-benzoyl-L-phenylalanyl-N-{(2S)-5-[(diaminomethylidene)amino]-2-[(4-nitrophenyl)amino]pentanoyl}-L-valinamide, with CAS number 54799-93-8, is a synthetic compound that belongs to the class of peptide derivatives. This substance features a complex structure characterized by the presence of multiple functional groups, including amide bonds, aromatic rings, and amino groups, which contribute to its potential biological activity. The compound is likely to exhibit properties such as solubility in polar solvents, given the presence of amino groups, and may interact with biological systems due to its peptide-like nature. Its specific stereochemistry, indicated by the presence of L-amino acids, suggests that it may have relevance in biological applications, possibly as a pharmaceutical agent or in biochemical research. The nitrophenyl group may also impart unique electronic properties, influencing its reactivity and interactions. Overall, this compound's intricate structure and functional groups make it a subject of interest in medicinal chemistry and drug design.
Formula:C33H40N8O6
InChI:InChI=1/C33H40N8O6/c1-21(2)28(39-31(44)27(20-22-10-5-3-6-11-22)38-29(42)23-12-7-4-8-13-23)32(45)40-30(43)26(14-9-19-36-33(34)35)37-24-15-17-25(18-16-24)41(46)47/h3-8,10-13,15-18,21,26-28,37H,9,14,19-20H2,1-2H3,(H,38,42)(H,39,44)(H4,34,35,36)(H,40,43,45)/t26-,27-,28-/m0/s1
SMILES:CC(C)[C@@H](C(=O)N=C([C@H](CCCNC(=N)N)Nc1ccc(cc1)N(=O)=O)O)N=C([C@H](Cc1ccccc1)N=C(c1ccccc1)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Bz-Phe-Val-Arg-pNA · HCl
CAS:A very good substrate for thrombin, trypsin, and papain. Bz-FVR-pNA cleavage by thrombin can also be used for a simple photometric assay of antithrombin III (heparin cofactor). Chromogenic substrate for cruzipain and subtilisin.Formula:C33H40N8O6·HClPurity:99.7%Color and Shape:WhiteMolecular weight:681.19S 2160
CAS:S 2160 is a synthetic chromogenic substrate for thrombin.Formula:C33H40N8O6Color and Shape:SolidMolecular weight:644.72Bz-Phe-Val-Arg-pNA·HCl
CAS:Bz-Phe-Val-Arg-pNA·HCl is an antibacterial agent that inhibits the synthesis of bacterial cell wall peptidoglycan by binding to the enzyme UDP-N-acetylmuramyl-L-alanyl-D-glutamate synthase. This compound has been shown to inhibit the growth of Gram negative bacteria and atypical bacteria, such as Staphylococcus aureus and Enterococcus faecalis. Bz-Phe-Val-Arg has also been shown to have immunomodulatory properties, which may be due to its ability to modify cellular immunity.
Formula:C33H40N8O6·HClPurity:Min. 95%Molecular weight:681.18 g/mol



