CAS 54799-93-8

N-benzoyl-L-phenylalanyl-N-{(2S)-5-[(diaminomethylidene)amino]-2-[(4-nitrophenyl)amino]pentanoyl}-L-valinamide

Description:

N-benzoyl-L-phenylalanyl-N-{(2S)-5-[(diaminomethylidene)amino]-2-[(4-nitrophenyl)amino]pentanoyl}-L-valinamide, with CAS number 54799-93-8, is a synthetic compound that belongs to the class of peptide derivatives. This substance features a complex structure characterized by the presence of multiple functional groups, including amide bonds, aromatic rings, and amino groups, which contribute to its potential biological activity. The compound is likely to exhibit properties such as solubility in polar solvents, given the presence of amino groups, and may interact with biological systems due to its peptide-like nature. Its specific stereochemistry, indicated by the presence of L-amino acids, suggests that it may have relevance in biological applications, possibly as a pharmaceutical agent or in biochemical research. The nitrophenyl group may also impart unique electronic properties, influencing its reactivity and interactions. Overall, this compound's intricate structure and functional groups make it a subject of interest in medicinal chemistry and drug design.

Formula: C₃₃H₄₀N₈O₆

InChI: InChI=1/C33H40N8O6/c1-21(2)28(39-31(44)27(20-22-10-5-3-6-11-22)38-29(42)23-12-7-4-8-13-23)32(45)40-30(43)26(14-9-19-36-33(34)35)37-24-15-17-25(18-16-24)41(46)47/h3-8,10-13,15-18,21,26-28,37H,9,14,19-20H2,1-2H3,(H,38,42)(H,39,44)(H4,34,35,36)(H,40,43,45)/t26-,27-,28-/m0/s1

SMILES: CC(C)[C@@H](C(=O)N=C([C@H](CCCNC(=N)N)Nc1ccc(cc1)N(=O)=O)O)N=C([C@H](Cc1ccccc1)N=C(c1ccccc1)O)O

Bz-Phe-Val-Arg-pNA · HCl

CAS: 54799-93-8

A very good substrate for thrombin, trypsin, and papain. Bz-FVR-pNA cleavage by thrombin can also be used for a simple photometric assay of antithrombin III (heparin cofactor). Chromogenic substrate for cruzipain and subtilisin.

Formula: C₃₃H₄₀N₈O₆·HCl

Purity: 99.7%

Color and Shape: White

Molecular weight: 681.19

Ref: 01-4002044

Bz-Phe-Val-Arg-pNA HCl

CAS: 54799-93-8

Bz-Phe-Val-Arg-pNA HCl

Color and Shape: Solid

Molecular weight: 644.72g/mol

Ref: 54-BIBA1041

S 2160

CAS: 54799-93-8

S 2160 is a synthetic chromogenic substrate for thrombin.

Formula: C₃₃H₄₀N₈O₆

Color and Shape: Solid

Molecular weight: 644.72

Ref: TM-T34461

Bz-Phe-Val-Arg-pNA·HCl

CAS: 54799-93-8

Bz-Phe-Val-Arg-pNA·HCl is an antibacterial agent that inhibits the synthesis of bacterial cell wall peptidoglycan by binding to the enzyme UDP-N-acetylmuramyl-L-alanyl-D-glutamate synthase. This compound has been shown to inhibit the growth of Gram negative bacteria and atypical bacteria, such as Staphylococcus aureus and Enterococcus faecalis. Bz-Phe-Val-Arg has also been shown to have immunomodulatory properties, which may be due to its ability to modify cellular immunity.

Formula: C₃₃H₄₀N₈O₆·HCl

Purity: Min. 95%

Molecular weight: 681.18 g/mol

Ref: 3D-FB110707