CAS 548-10-7

Oxychelidonine

Description:

Oxychelidonine, with the CAS number 548-10-7, is an alkaloid derived from various plant sources, particularly those in the family of Solanaceae. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Oxychelidonine exhibits a range of pharmacological properties, including potential analgesic and anti-inflammatory effects, making it of interest in medicinal chemistry. Its solubility profile typically indicates moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. The compound's interactions with biological systems are mediated through its ability to bind to specific receptors, which can lead to various physiological responses. As with many alkaloids, caution is advised regarding its toxicity and side effects, necessitating further research to fully understand its therapeutic potential and safety profile. Overall, oxychelidonine represents a fascinating subject for further study in both natural product chemistry and pharmacology.

Formula: C₂₀H₁₇NO₆

InChI: InChI=1S/C20H17NO6/c1-21-18-11-6-15-14(25-7-26-15)5-9(11)4-12(22)16(18)10-2-3-13-19(27-8-24-13)17(10)20(21)23/h2-3,5-6,12,16,18,22H,4,7-8H2,1H3

InChI key: InChIKey=UPVAYLMWVRMHNE-UHFFFAOYSA-N

SMILES: OC1C2C(C=3C(C1)=CC4=C(C3)OCO4)N(C)C(=O)C=5C2=CC=C6C5OCO6

Synonyms:

• 6-Oxochelidonine
• Chelidonine, 6-oxo-
• Oxychelidonine
• [1,3]Benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-14(5bH)-one, 6,7,12b,13-tetrahydro-6-hydroxy-13-methyl-, (5bR,6S,12bS)-
• (5bR,6S,12bS)-6,7,12b,13-Tetrahydro-6-hydroxy-13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-14(5bH)-one

Oxychelidonine

CAS: 548-10-7

Oxychelidonine is a chemical compound that is extracted from the leaves of the Oxycoccus vernus plant. Studies have shown that oxychelidonine has significant cytotoxicity against various cancer cells, including those of the breast, prostate, and colon. It is believed to induce apoptotic cell death by inhibiting DNA synthesis and by blocking protein synthesis in cancer cells. Oxychelidonine also inhibits bacterial growth. The extract shows significant cytotoxicity against gram-negative bacteria such as Escherichia coli and Salmonella typhimurium. It has been shown to inhibit the growth of Aspergillus fumigatus, which is a fungus that causes aspergillosis, a type of lung infection. Oxychelidonine can be used in moxibustion treatments for certain conditions such as bronchitis or asthma. Moxibustion involves burning an herb called mugwort (Artemisia vulgaris) on or

Formula: C₂₀H₁₇NO₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 367.35 g/mol

Ref: 3D-FO65936