CAS 548-31-2: Oxynitidine

Description:Oxynitidine, with the CAS number 548-31-2, is a chemical compound that belongs to the class of pharmaceuticals known as antihistamines. It is primarily characterized by its ability to act as a histamine H1 receptor antagonist, which makes it useful in alleviating allergic reactions and symptoms associated with conditions such as hay fever and urticaria. The molecular structure of oxynitidine includes functional groups that contribute to its pharmacological activity, and it typically exhibits properties such as solubility in polar solvents and moderate stability under standard conditions. As with many antihistamines, it may have sedative effects, although the extent can vary based on the specific formulation and dosage. Additionally, oxynitidine's safety profile and potential side effects are important considerations in its therapeutic use, necessitating careful dosage and monitoring in clinical settings. Overall, oxynitidine represents a significant compound in the realm of allergy treatment, showcasing the intricate relationship between chemical structure and biological activity.

Formula:C₂₁H₁₇NO₅

InChI:InChI=1S/C21H17NO5/c1-22-20-12(5-4-11-6-18-19(7-13(11)20)27-10-26-18)14-8-16(24-2)17(25-3)9-15(14)21(22)23/h4-9H,10H2,1-3H3

InChI key:InChIKey=TVYBYUSEIMYSFA-UHFFFAOYSA-N

SMILES:O=C1C2=CC(OC)=C(OC)C=C2C=3C=CC4=CC=5OCOC5C=C4C3N1C