CAS 548-37-8
:Verbenalin
Description:
Verbenalin, with the CAS number 548-37-8, is a chemical compound classified as a bicyclic monoterpene. It is primarily derived from the essential oil of various plants, particularly those in the Lamiaceae family, such as certain species of mint. Verbenalin is known for its characteristic pleasant aroma, which contributes to its use in perfumery and flavoring applications. The compound exhibits a range of biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmacological research. Its structure features a bicyclic framework, which is typical of many terpenes, and it can undergo various chemical reactions, including oxidation and isomerization. Verbenalin is generally considered to be stable under standard conditions, but like many organic compounds, it should be handled with care to avoid degradation or unwanted reactions. Overall, verbenalin's unique properties and potential applications make it a subject of interest in both the natural product chemistry and pharmaceutical fields.
Formula:C17H24O10
InChI:InChI=1S/C17H24O10/c1-6-3-8(19)11-7(15(23)24-2)5-25-16(10(6)11)27-17-14(22)13(21)12(20)9(4-18)26-17/h5-6,9-14,16-18,20-22H,3-4H2,1-2H3/t6-,9+,10+,11-,12+,13-,14+,16-,17-/m0/s1
InChI key:InChIKey=HLXRWTJXGMHOFN-XJSNKYLASA-N
SMILES:O([C@H]1[C@]2([C@@](C(C(OC)=O)=CO1)(C(=O)C[C@@H]2C)[H])[H])[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O
Synonyms:- 5-Deoxyhastatoside
- Cornin (glycoside)
- Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-7-methyl-5-oxo-, methyl ester, (1S,4aS,7S,7aR)-
- Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-7-methyl-5-oxo-, methyl ester, [1S-(1α,4aα,7α,7aα)]-
- Methyl 1-(Hexopyranosyloxy)-7-Methyl-5-Oxo-1,4A,5,6,7,7A-Hexahydrocyclopenta[C]Pyran-4-Carboxylate
- NSC 118055
- Verbenalin
- Verbenaloside
- methyl (1S,4aS,7S,7aR)-1-(beta-D-glucopyranosyloxy)-7-methyl-5-oxo-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
- Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-7-methyl-5-oxo-, methyl ester, (1S,4aS,7S,7aR)-
- Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-7-methyl-5-oxo-, methyl ester, [1S-(1α,4aα,7α,7aα)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Verbenalin
CAS:Verbenalin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C17H24O10Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:388.37Verbenalin
CAS:Formula:C17H24O10Purity:(HPLC) ≥ 98.0%Color and Shape:White to off-white powderMolecular weight:388.37Verbenalin
CAS:Verbenalin (Verbenaloside) induces angiogenesis via a programmed PI3K/Akt/eNOS/VEGF signaling axis.Formula:C17H24O10Purity:98.81% - 99.88%Color and Shape:Off-White PowderMolecular weight:388.37Verbenalin
CAS:Natural glycosideFormula:C17H24O10Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:388.37Verbenalin
CAS:<p>Verbenalin is an iridoid glycoside, which is a naturally occurring compound sourced from the plant genus Verbena, notably from Verbena officinalis. It is characterized by its cyclic monoterpene structure linked to a sugar moiety. This compound is known for its biological activity, primarily influencing the nervous system.</p>Formula:C17H24O10Purity:Min. 95%Molecular weight:388.37 g/mol
