CAS 548-76-5: Irigenin
Description:Irigenin, with the CAS number 548-76-5, is a naturally occurring flavonoid compound primarily found in various plant species, particularly in the genus Iris. It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Irigenin exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in pharmacological research. The compound is typically soluble in organic solvents and has limited solubility in water, which is common for many flavonoids. Its molecular structure includes multiple hydroxyl groups, enhancing its reactivity and interaction with biological systems. Irigenin's potential therapeutic applications are being explored, particularly in the context of traditional medicine, where it has been used for its health benefits. However, further studies are necessary to fully understand its mechanisms of action and efficacy in clinical settings. As with many natural compounds, the extraction and purification processes can influence its availability and potency in research and therapeutic applications.
Formula:C18H16O8
InChI:InChI=1S/C18H16O8/c1-23-13-5-8(4-10(19)17(13)24-2)9-7-26-12-6-11(20)18(25-3)16(22)14(12)15(9)21/h4-7,19-20,22H,1-3H3
InChI key:InChIKey=TUGWPJJTQNLKCL-UHFFFAOYSA-N
SMILES:O=C1C(=COC2=CC(O)=C(OC)C(O)=C12)C=3C=C(O)C(OC)=C(OC)C3
- Synonyms:
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-
- 5,7-Dihydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
- 5,7-dihydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4H-chromen-4-one
- Irigenin
- Isoflavone, 3′,5,7-trihydroxy-4′,5′,6-trimethoxy-
