CAS 54802-10-7: 3-amino-1-benzofuran-2-carboxamide

Description:3-Amino-1-benzofuran-2-carboxamide is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. The presence of an amino group (-NH2) and a carboxamide group (-C(=O)NH2) contributes to its chemical reactivity and potential biological activity. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxamide functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with benzofuran moieties are often investigated for their anti-inflammatory, analgesic, and antimicrobial properties. The compound's CAS number, 54802-10-7, allows for precise identification in chemical databases and literature. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 3-amino-1-benzofuran-2-carboxamide represents a versatile scaffold for further chemical modifications and research.

Formula:C₉H₈N₂O₂

InChI:InChI=1/C9H8N2O2/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H,10H2,(H2,11,12)

Synonyms:
3-Amino-benzofuran-2-carboxylic acid amide

Found 5 products.

Product data	Purity	Price range	Estimated delivery
3-Aminobenzofuran-2-carboxamide REF: 3B-A2832CAS: 54802-10-7	>98.0%(GC)	51.00 €~173.00 €	Wed 09 Apr 25
3-Aminobenzofuran-2-carboxamide REF: IN-DA003ITPCAS: 54802-10-7	95%	25.00 €~170.00 €	Wed 16 Apr 25
3-Aminobenzofuran-2-carboxamide REF: 54-OR95870CAS: 54802-10-7	99+%	32.00 €~766.00 €	Thu 17 Apr 25
3-AMINOBENZOFURAN-2-CARBOXAMIDE REF: 10-F466615CAS: 54802-10-7	97.0%	To inquire	Mon 28 Apr 25
3-Aminobenzofuran-2-carboxamide REF: 3D-FA55348CAS: 54802-10-7	- - -	- - -	Discontinued product