CAS 54802-19-6

5,6,7,8-tetrahydroquinolin-2(1H)-one

Description:

5,6,7,8-Tetrahydroquinolin-2(1H)-one is a bicyclic organic compound characterized by its fused ring structure, which includes a quinoline moiety. This compound features a saturated tetrahydroquinoline ring system with a carbonyl group at the 2-position, contributing to its classification as a ketone. It is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. The presence of the nitrogen atom in the ring structure imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and cyclizations. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its derivatives are often explored for their pharmacological applications, making it a subject of research in drug development. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₉H₁₁NO

InChI: InChI=1/C9H11NO/c11-9-6-5-7-3-1-2-4-8(7)10-9/h5-6H,1-4H2,(H,10,11)

SMILES: C1CCc2c(C1)ccc(n2)O

Synonyms:

• 2(1H)-Quinolinone, 5,6,7,8-tetrahydro-
• 2-Quinolinol, 5,6,7,8-Tetrahydro-
• 5,6,7,8-Tetrahydroquinolin-2-ol
• 5,6,7,8-Tetrahydroquinolin-2(1H)-one

5,6,7,8-TETRAHYDRO-2(1H)-QUINOLINONE

CAS: 54802-19-6

Formula: C₉H₁₁NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 149.1897

Ref: IN-DA00DDTG

5,6,7,8-Tetrahydroquinolin-2(1H)-one

CAS: 54802-19-6

5,6,7,8-Tetrahydroquinolin-2(1H)-one

Purity: 97%

Molecular weight: 149.19g/mol

Ref: 54-OR902091

5,6,7,8-Tetrahydroquinolin-2(1H)-one

CAS: 54802-19-6

Formula: C₉H₁₁NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 149.193

Ref: 10-F038560

5,6,7,8-Tetrahydroquinolin-2(1H)-one

CAS: 54802-19-6

Tetrahydroquinolin-2(1H)-one is a hydrobromide that has been found in the environment as an environmental pollutant. Tetrahydroquinolin-2(1H)-one is used to synthesize amides and has been studied by single-crystal x-ray diffraction. The molecule is centrosymmetric, with a molecular weight of 244.06 g/mol. Tetrahydroquinolin-2(1H)-one can be used as a ligand for metals such as chlorine and magnesium. It does not dissolve in water but does dissolve in organic solvents such as ethers, chloroform, or benzene.

Formula: C₉H₁₁NO

Purity: Min. 95%

Molecular weight: 149.19 g/mol

Ref: 3D-ECA80219