CAS 54809-74-4
:sophoridine N-oxide
Description:
Sophoridine N-oxide is a chemical compound derived from the alkaloid sophoridine, which is primarily found in certain species of the Sophora plant. This compound is characterized by its unique molecular structure, which includes a nitrogen atom in an oxidized state, contributing to its classification as an N-oxide. Sophoridine N-oxide exhibits various biological activities, including potential anti-inflammatory and neuroprotective effects, making it of interest in pharmacological research. The compound is typically studied for its interactions with biological systems and its potential therapeutic applications. In terms of physical properties, sophoridine N-oxide is usually a solid at room temperature and may exhibit solubility in polar solvents. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many alkaloids, it is essential to handle sophoridine N-oxide with care due to its biological activity and potential toxicity. Further research is ongoing to fully elucidate its mechanisms of action and potential uses in medicine.
Formula:C15H24N2O2
InChI:InChI=1/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12-,13-,15+,17?/m1/s1
Synonyms:- Oxysophoridine
- 1H,5H,10H-Dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one,dodecahydro-, 4-oxide, (7aR,13aR,13bR,13cS)-
- Matridin-15-one, 1-oxide,(5β)-
- N-Oxysophoridine
- Sophor
- (-)-Sophoridine N-oxide
- Matridin-15-one, 1-oxide,(5尾)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(41S,7aR,13aR,13bR)-10-Oxododecahydro-1H,5H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridine 4(41H)-oxide
CAS:Formula:C15H24N2O2Purity:98%Molecular weight:264.3633Oxysophoridine
CAS:Oxysophoridine protects against brain ischemia and heart damage through antioxidant, anti-apoptotic, and anti-inflammatory effects.Formula:C15H24N2O2Purity:98.15% - >99.99%Color and Shape:SolidMolecular weight:264.36




