CAS 54819-86-2
:Propanoic acid, 2-chloro-, butyl ester
Description:
Propanoic acid, 2-chloro-, butyl ester, also known as butyl 2-chloropropanoate, is an organic compound characterized by its ester functional group derived from propanoic acid and butanol. It typically appears as a colorless to pale yellow liquid with a fruity odor, indicative of its ester nature. The compound is moderately soluble in water, but more soluble in organic solvents such as ethanol and ether. Its molecular structure includes a propanoic acid backbone with a chlorine atom substituted at the second carbon, which can influence its reactivity and properties. This compound is often used in organic synthesis and as an intermediate in the production of various chemicals. It may also exhibit properties typical of esters, such as being flammable and having a relatively low boiling point. Safety precautions should be taken when handling this substance, as it may cause irritation to the skin, eyes, and respiratory system. Proper storage in a cool, well-ventilated area away from sources of ignition is recommended.
Formula:C7H13ClO2
InChI:InChI=1/C7H13ClO2/c1-3-4-5-10-7(9)6(2)8/h6H,3-5H2,1-2H3
InChI key:InChIKey=KATNUXHENWPMQJ-UHFFFAOYSA-N
SMILES:C(OCCCC)(C(C)Cl)=O
Synonyms:- Ai3-33774
- Butyl 2-Chloropropanoate
- Butyl α-chloropropionate
- Propanoic acid, 2-chloro-, butyl ester
- n-Butyl 2-chloropropionate
- Butyl 2-chloropropionate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Butyl 2-chloropropanoate
CAS:<p>Butyl 2-chloropropanoate is a synthetic compound that can be derived by reacting butyl chloride and propanol in the presence of persulfate. The reaction yields two products, with the desired product being the major product. Butyl 2-chloropropanoate has been used as a reactant in organic synthesis to generate disulphides and hydroxy groups. Optimization of the reaction parameters has resulted in a faster reaction time and higher yield. Butyl 2-chloropropanoate is typically used as a solvent for other reactions due to its ability to dissolve halides, such as chloroformates and bromides, and hydrocarbons, such as hexane or benzene.</p>Formula:C7H13ClO2Purity:Min. 95%Molecular weight:164.63 g/mol
