CAS 54828-05-6
:1-methyl-4-nitro-1H-imidazole-5-carboxylic acid
Description:
1-Methyl-4-nitro-1H-imidazole-5-carboxylic acid is a heterocyclic organic compound characterized by its imidazole ring, which contains both a methyl and a nitro group as substituents. The presence of the carboxylic acid functional group contributes to its acidic properties, making it soluble in polar solvents. This compound typically exhibits a yellow to orange color due to the nitro group, which can also influence its reactivity and interaction with other chemical species. It is often used in pharmaceutical research and as an intermediate in the synthesis of various bioactive compounds. The nitro group can participate in electrophilic substitution reactions, while the carboxylic acid can engage in acid-base reactions. Additionally, the compound's structure allows for potential hydrogen bonding, which can affect its solubility and interaction with biological systems. Overall, 1-methyl-4-nitro-1H-imidazole-5-carboxylic acid is notable for its unique structural features and potential applications in medicinal chemistry.
Formula:C5H5N3O4
InChI:InChI=1/C5H5N3O4/c1-7-2-6-4(8(11)12)3(7)5(9)10/h2H,1H3,(H,9,10)
SMILES:Cn1cnc(c1C(=O)O)N(=O)=O
Synonyms:- 1H-imidazole-5-carboxylic acid, 1-methyl-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Methyl-4-nitro-1H-imidazole-5-carboxylic Acid
CAS:Controlled ProductApplications A derivative of imidazole used in the synthesis of heteroxanthine.
References Sarasin, J., et al.: Helv. Chim. Acta, 7, 713 (1924),Formula:C5H5N3O4Color and Shape:NeatMolecular weight:171.11
