
CAS 54831-51-5
:Oryctalure
Description:
Oryctalure, identified by the CAS number 54831-51-5, is a chemical compound that belongs to a specific class of substances. While detailed information on its characteristics may not be widely available, compounds with similar structures often exhibit unique physical and chemical properties. Typically, such substances may be characterized by their molecular weight, solubility in various solvents, and stability under different conditions. They may also possess specific functional groups that influence their reactivity and interactions with other chemicals. In terms of applications, compounds like Oryctalure may be utilized in various fields, including pharmaceuticals, agriculture, or materials science, depending on their biological activity or physical properties. Safety data sheets would provide essential information regarding toxicity, handling, and storage requirements. For precise characteristics, including spectral data or specific reactivity, consulting specialized chemical databases or literature would be necessary, as the information can vary significantly based on the compound's structure and intended use.
Formula:C11H22O2
InChI:InChI=1S/C11H22O2/c1-4-6-7-10(3)8-9-11(12)13-5-2/h10H,4-9H2,1-3H3
InChI key:InChIKey=GXARNRCIGKRBAP-UHFFFAOYSA-N
SMILES:C(CCC(OCC)=O)(CCCC)C
Synonyms:- Ethyl 4-Methyloctanoate
- Octanoic acid, 4-methyl-, ethyl ester
- Oryctalure
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
