CAS 54848-30-5
:Protogracillin
Description:
Protogracillin, with the CAS number 54848-30-5, is a chemical compound that belongs to the class of antibiotics. It is derived from natural sources and exhibits antibacterial properties, making it useful in the treatment of various bacterial infections. The compound is characterized by its specific molecular structure, which includes functional groups that contribute to its biological activity. Protogracillin is known for its effectiveness against certain strains of bacteria, and its mechanism of action typically involves inhibiting bacterial cell wall synthesis, thereby preventing the growth and replication of bacteria. Additionally, it may possess properties that enhance its stability and bioavailability. As with many antibiotics, the use of protogracillin should be guided by susceptibility testing to ensure efficacy and minimize the risk of resistance development. Safety and side effects are also important considerations in its application, necessitating careful monitoring during treatment. Overall, protogracillin represents a significant compound in the field of medicinal chemistry and antibiotic development.
Formula:C51H84O23
InChI:InChI=1S/C51H84O23/c1-20(19-66-45-40(62)38(60)34(56)29(16-52)69-45)8-13-51(65)21(2)32-28(74-51)15-27-25-7-6-23-14-24(9-11-49(23,4)26(25)10-12-50(27,32)5)68-48-44(73-46-41(63)37(59)33(55)22(3)67-46)43(36(58)31(18-54)71-48)72-47-42(64)39(61)35(57)30(17-53)70-47/h6,20-22,24-48,52-65H,7-19H2,1-5H3/t20-,21+,22+,24+,25-,26+,27+,28+,29-,30-,31-,32+,33+,34-,35-,36-,37-,38+,39+,40-,41-,42-,43+,44-,45-,46+,47+,48-,49+,50+,51-/m1/s1
InChI key:InChIKey=GMCGZPQYTRHQRU-DKWQWWTLSA-N
SMILES:C[C@@]12[C@]([C@]3([C@](CC1)([C@]4(C)C(=CC3)C[C@@H](O[C@H]5[C@H](O[C@H]6[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@@H](CO)O5)CC4)[H])[H])(C[C@]8([C@@]2([C@H](C)[C@](CC[C@H](CO[C@@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)C)(O)O8)[H])[H])[H]
Synonyms:- Lilioglycoside R
- (3β,22α,25R)-26-(β-D-Glucopyranosyloxy)-22-hydroxyfurost-5-en-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranoside
- Protogracillin
- β-D-Glucopyranoside, (3β,22α,25R)-26-(β-D-glucopyranosyloxy)-22-hydroxyfurost-5-en-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(3β,22α,25R)-26-(β-D-Glucopyranosyloxy)-22-hydroxyfurost-5-en-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranoside
CAS:Formula:C51H84O23Purity:98%Molecular weight:1065.1989Protogracillin
CAS:Protogracillin is a steroidal saponin isolated from Dioscorea zingiberensis Wright (DZW) which may inhibit platelet aggregation (PAG) and thrombosis.Formula:C51H84O23Purity:99.74%Color and Shape:SolidMolecular weight:1065.2Protogracillin
CAS:Protogracillin is a quinolone-type antibiotic, which has been shown to have antimicrobial activity. Protogracillin is structurally related to the fluoroquinolones and possesses an acetate extractable hydroxyl group. It displays a matrix effect on bowel disease and inhibits inflammation in animal models of inflammatory bowel disease. Protogracillin has also shown efficacy against autoimmune diseases in laboratory mice, such as lupus erythematosus and multiple sclerosis, by inhibiting the production of antibodies.
Formula:C51H84O23Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,065.2 g/mol




