CAS 54854-91-0

3-Furanmethanol, 4-(1,3-benzodioxol-5-ylmethyl)tetrahydro-2-(4-hydroxy-3-methoxyphenyl)-

Description:

3-Furanmethanol, 4-(1,3-benzodioxol-5-ylmethyl)tetrahydro-2-(4-hydroxy-3-methoxyphenyl)-, with the CAS number 54854-91-0, is a complex organic compound characterized by its unique structural features. It contains a furan ring, which is a five-membered aromatic ring with oxygen, and a tetrahydrofuran moiety, indicating the presence of a saturated cyclic ether. The compound also features a benzodioxole group, which is known for its potential biological activity, and a phenolic hydroxyl group that can participate in hydrogen bonding and contribute to its reactivity. The methoxy group attached to the phenyl ring enhances its lipophilicity and may influence its interaction with biological systems. This compound may exhibit various properties such as antioxidant activity, and its structural components suggest potential applications in pharmaceuticals or as a chemical intermediate. However, specific physical properties like melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₀H₂₂O₆

InChI: InChI=1S/C20H22O6/c1-23-18-8-13(3-4-16(18)22)20-15(9-21)14(10-24-20)6-12-2-5-17-19(7-12)26-11-25-17/h2-5,7-8,14-15,20-22H,6,9-11H2,1H3

InChI key: InChIKey=GRYMYKQGSSTJBA-UHFFFAOYSA-N

SMILES: C(O)C1C(OCC1CC=2C=C3C(=CC2)OCO3)C4=CC(OC)=C(O)C=C4

Synonyms:

• 3-Furanmethanol, 4-(1,3-benzodioxol-5-ylmethyl)tetrahydro-2-(4-hydroxy-3-methoxyphenyl)-
• Sanshodiol

Tetrahydro-4-(1,3-benzodioxol-5-ylmethyl)-2-(4-hydroxy-3-methoxyphenyl)-3-furanmethanol

CAS: 54854-91-0

Formula: C₂₀H₂₂O₆

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 358.3851

Ref: IN-DA00DK0A

Sanshodiol

CAS: 54854-91-0

Sanshodiol is a natural product of Zanthoxylum, Rutaceae.

Formula: C₂₀H₂₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 358.39

Ref: TM-T3833

Sanshodiol

CAS: 54854-91-0

Formula: C₂₀H₂₂O₆

Purity: 95%~99%

Molecular weight: 358.39

Ref: BP-SBP03184

Sanshodiol

CAS: 54854-91-0

Sanshodiol is a natural compound, which is a bioactive molecule derived from the plant Zanthoxylum bungeanum, commonly known as Sichuan pepper. It functions primarily through the modulation of inflammatory pathways and may act as an inhibitor of pro-inflammatory cytokines and enzymes, thus exhibiting potential as an anti-inflammatory agent. Sanshodiol's mode of action involves the suppression of NF-kB activation and the inhibition of cyclooxygenase and lipoxygenase pathways, contributing to its anti-inflammatory effects.

The primary applications of Sanshodiol are in scientific research exploring its therapeutic potential in treating inflammatory disorders and possibly other related diseases. Its properties make it a subject of interest for further study in pharmacology and biochemistry, serving as a candidate for drug development projects aiming to mitigate inflammation-related conditions. Researchers in the field are investigating its efficacy and safety profile, making it a significant focus for ongoing experimental studies.

Formula: C₂₀H₂₂O₆

Purity: Min. 95%

Molecular weight: 358.4 g/mol

Ref: 3D-ECA85491