CAS 54856-61-0

2-amino-5-chloropyridine-3-carbaldehyde

Description:

2-Amino-5-chloropyridine-3-carbaldehyde is an organic compound characterized by its pyridine ring structure, which includes an amino group and a chlorinated substituent. The presence of the aldehyde functional group contributes to its reactivity, making it a valuable intermediate in organic synthesis. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in the synthesis of more complex molecules. The amino group can participate in various chemical reactions, such as nucleophilic substitutions, while the aldehyde can undergo condensation reactions. Additionally, the chlorine atom introduces unique electronic properties, influencing the compound's reactivity and interactions with other molecules. Overall, 2-amino-5-chloropyridine-3-carbaldehyde is a versatile compound with significant implications in synthetic chemistry and material science.

Formula: C₆H₅ClN₂O

InChI: InChI=1/C6H5ClN2O/c7-5-1-4(3-10)6(8)9-2-5/h1-3H,(H2,8,9)

SMILES: c1c(C=O)c(=N)[nH]cc1Cl

Synonyms:

• 2-Amino-5-chloronicotinaldehyde
• 3-Pyridinecarboxaldehyde, 2-amino-5-chloro-

2-Amino-5-chloronicotinaldehyde

CAS: 54856-61-0

Formula: C₆H₅ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.5697

Ref: IN-DA00DBU0

2-Amino-5-chloronicotinaldehyde

CAS: 54856-61-0

2-Amino-5-chloronicotinaldehyde

Purity: 97%

Color and Shape: Solid

Molecular weight: 156.57g/mol

Ref: 54-OR70015

2-Amino-5-chloronicotinaldehyde

CAS: 54856-61-0

Formula: C₆H₅ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.57

Ref: 10-F046567