CAS 5486-77-1

Alloclamide

Description:

Alloclamide, with the CAS number 5486-77-1, is a chemical compound that belongs to the class of amides. It is characterized by its structural features, which include a carbonyl group (C=O) directly bonded to a nitrogen atom (N), typical of amide compounds. Alloclamide is known for its potential applications in various fields, including pharmaceuticals and organic synthesis. The compound exhibits moderate solubility in polar solvents, which is common for amides due to their ability to engage in hydrogen bonding. Alloclamide's stability and reactivity can vary depending on the surrounding conditions, such as pH and temperature. Additionally, it may possess specific biological activities, making it of interest in medicinal chemistry. However, detailed information regarding its toxicity, environmental impact, and specific applications may require further investigation through scientific literature and safety data sheets. Overall, Alloclamide represents a versatile compound with potential utility in chemical research and development.

Formula: C₁₆H₂₃ClN₂O₂

InChI: InChI=1S/C16H23ClN2O2/c1-4-11-21-15-12-13(17)7-8-14(15)16(20)18-9-10-19(5-2)6-3/h4,7-8,12H,1,5-6,9-11H2,2-3H3,(H,18,20)

InChI key: InChIKey=UHWFVIPXDFZTFA-UHFFFAOYSA-N

SMILES: C(NCCN(CC)CC)(=O)C1=C(OCC=C)C=C(Cl)C=C1

Synonyms:

• 4-Chloro-N-[2-(diethylamino)ethyl]-2-(2-propen-1-yloxy)benzamide
• Benzamide, 2-(allyloxy)-4-chloro-N-[2-(diethylamino)ethyl]-
• Benzamide, 4-chloro-N-[2-(diethylamino)ethyl]-2-(2-propen-1-yloxy)-
• Alloclamide
• Benzamide, 4-chloro-N-[2-(diethylamino)ethyl]-2-(2-propenyloxy)-

Alloclamide

CAS: 5486-77-1

Alloclamide is a bioactive chemical.

Formula: C₁₆H₂₃ClN₂O₂

Color and Shape: Solid

Molecular weight: 310.82

Ref: TM-T29880L