CymitQuimica logo

CAS 54864-83-4

:

6-Chloro-N,N-dimethyl-3-pyridinecarboxamide

Description:
6-Chloro-N,N-dimethyl-3-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 6-position and a dimethylamino group at the 3-position contributes to its unique properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents, reflecting its polar functional groups. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. The amide functional group enhances its potential for hydrogen bonding, influencing its solubility and reactivity. Additionally, the chloro substituent can affect the compound's electronic properties and reactivity, potentially making it a useful intermediate in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C8H9ClN2O
InChI:InChI=1S/C8H9ClN2O/c1-11(2)8(12)6-3-4-7(9)10-5-6/h3-5H,1-2H3
InChI key:InChIKey=BPMBBXCPGAFTCX-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C=1C=CC(Cl)=NC1
Synonyms:
  • 2-Chloro-5-(N,N-dimethylcarbamoyl)pyridine
  • 3-Pyridinecarboxamide, 6-chloro-N,N-dimethyl-
  • 6-Chloro-N,N-dimethyl-3-pyridinecarboxamide
  • 6-chloro-N,N-dimethylpyridine-3-carboxamide
  • 6-Chloro-N,N-dimethylnicotinamide
Found 4 products.