CAS 5487-33-2

(3-(benzyloxy)-4-methoxyphenyl)acetic acid

Description:

(3-(Benzyloxy)-4-methoxyphenyl)acetic acid, with the CAS number 5487-33-2, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with both a benzyloxy group and a methoxy group, contributing to its chemical reactivity and solubility properties. The presence of the acetic acid moiety indicates that it can participate in acid-base reactions, making it a potential candidate for various chemical syntheses and applications. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic groups and the hydrophilic carboxylic acid functional group. Its structural characteristics may also influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, (3-(benzyloxy)-4-methoxyphenyl)acetic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₆H₁₆O₄

InChI: InChI=1/C16H16O4/c1-19-14-8-7-13(10-16(17)18)9-15(14)20-11-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,17,18)

SMILES: COc1ccc(cc1OCc1ccccc1)CC(=O)O

2-(3-(Benzyloxy)-4-methoxyphenyl)acetic acid

CAS: 5487-33-2

Formula: C₁₆H₁₆O₄

Color and Shape: Solid

Molecular weight: 272.2958

Ref: IN-DA00DF2I

2-[3-(Benzyloxy)-4-methoxyphenyl]acetic acid

CAS: 5487-33-2

2-[3-(Benzyloxy)-4-methoxyphenyl]acetic acid

Purity: ≥95%

Molecular weight: 272.30g/mol

Ref: 54-OR470792