CAS 548772-42-5

2-Thiopheneethanamine, 5-chloro-, hydrochloride (1:1)

Description:

2-Thiopheneethanamine, 5-chloro-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which contributes to its aromatic properties. The presence of the amino group (-NH2) indicates that it is an amine, which can participate in various chemical reactions, including nucleophilic substitutions and protonation. The 5-chloro substitution on the thiophene ring enhances its reactivity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for applications in pharmaceuticals and research. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and it may be studied for its pharmacological properties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₈ClNS.ClH

InChI: InChI=1S/C6H8ClNS.ClH/c7-6-2-1-5(9-6)3-4-8;/h1-2H,3-4,8H2;1H

InChI key: InChIKey=POJXZNWFJAMOSA-UHFFFAOYSA-N

SMILES: C(CN)C=1SC(Cl)=CC1.Cl

2-(5-Chlorothiophen-2-yl)ethanamine hydrochloride

CAS: 548772-42-5

Formula: C₆H₉Cl₂NS

Color and Shape: Solid

Molecular weight: 198.1134

Ref: IN-DA00DJRF

2-(5-Chlorothiophen-2-yl)ethan-1-amine hydrochloride

CAS: 548772-42-5

Versatile small molecule scaffold

Formula: C₆H₈ClNS·HCl

Purity: Min. 95%

Molecular weight: 198.12 g/mol

Ref: 3D-YWA77242