CAS 5488-36-8

4,4-dimethylisoquinoline-1,3(2H,4H)-dione

Description:

4,4-Dimethylisoquinoline-1,3(2H,4H)-dione, with the CAS number 5488-36-8, is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused ring system containing nitrogen. This compound typically exhibits a yellow to orange color and is known for its potential biological activity, including antimicrobial and anticancer properties. It is a derivative of isoquinoline, which contributes to its aromaticity and stability. The presence of two methyl groups at the 4-position enhances its lipophilicity, potentially influencing its solubility and reactivity. The dione functional groups indicate that it contains two carbonyl (C=O) groups, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. This compound may be utilized in synthetic organic chemistry and medicinal chemistry for the development of new pharmaceuticals. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₁H₁₁NO₂

InChI: InChI=1/C11H11NO2/c1-11(2)8-6-4-3-5-7(8)9(13)12-10(11)14/h3-6H,1-2H3,(H,12,13,14)

SMILES: CC1(C)c2ccccc2C(=NC1=O)O

4,4-Dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione

CAS: 5488-36-8

Formula: C₁₁H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 189.2105

Ref: IN-DA00VUE0

4,4-Dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione

CAS: 5488-36-8

4,4-Dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione

Purity: 95%

Molecular weight: 189.21g/mol

Ref: 54-OR1046880

4,4-Dimethylisoquinoline-1,3(2H,4H)-dione

CAS: 5488-36-8

Purity: 95%

Molecular weight: 189.2140045

Ref: 10-F602368

4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione

Controlled Product

CAS: 5488-36-8

Applications 4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione (cas# 5488-36-8) is a useful research chemical.

Formula: C₁₁H₁₁NO₂

Color and Shape: Neat

Molecular weight: 189.21

Ref: TR-D457978

4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione

CAS: 5488-36-8

4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione is an antiplatelet agent that inhibits the activity of the platelet cyclooxygenase enzyme and prevents the production of thromboxane A2. It has been shown to be a potent compound that has antiplatelet effects in vitro and in vivo. 4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione is used for the treatment of patients with atherosclerosis or coronary artery disease who have had a recent stroke or heart attack. This drug also shows promise as an anticonvulsant and analgesic due to its ability to reduce neuronal excitability.

Formula: C₁₁H₁₁NO₂

Purity: Min. 95%

Molecular weight: 189.21 g/mol

Ref: 3D-FAA48836